// source --> https://www.slovacko.cz/wp-content/themes/slovacko_theme/js/daterangepicker.min.js?ver=5.2.7
/**
* Minified by jsDelivr using Terser v3.14.1.
* Original file: /npm/daterangepicker@3.0.5/daterangepicker.js
*
* Do NOT use SRI with dynamically generated files! More information: https://www.jsdelivr.com/using-sri-with-dynamic-files
*/
!function(t,e){if("function"==typeof define&&define.amd)define(["moment","jquery"],function(t,a){return a.fn||(a.fn={}),"function"!=typeof t&&t.default&&(t=t.default),e(t,a)});else if("object"==typeof module&&module.exports){var a="undefined"!=typeof window?window.jQuery:void 0;a||(a=require("jquery")).fn||(a.fn={});var i="undefined"!=typeof window&&void 0!==window.moment?window.moment:require("moment");module.exports=e(i,a)}else t.daterangepicker=e(t.moment,t.jQuery)}(this,function(t,e){var a=function(a,i,s){if(this.parentEl="body",this.element=e(a),this.startDate=t().startOf("day"),this.endDate=t().endOf("day"),this.minDate=!1,this.maxDate=!1,this.maxSpan=!1,this.autoApply=!1,this.singleDatePicker=!1,this.showDropdowns=!1,this.minYear=t().subtract(100,"year").format("YYYY"),this.maxYear=t().add(100,"year").format("YYYY"),this.showWeekNumbers=!1,this.showISOWeekNumbers=!1,this.showCustomRangeLabel=!0,this.timePicker=!1,this.timePicker24Hour=!1,this.timePickerIncrement=1,this.timePickerSeconds=!1,this.linkedCalendars=!0,this.autoUpdateInput=!0,this.alwaysShowCalendars=!1,this.ranges={},this.opens="right",this.element.hasClass("pull-right")&&(this.opens="left"),this.drops="down",this.element.hasClass("dropup")&&(this.drops="up"),this.buttonClasses="btn btn-sm",this.applyButtonClasses="btn-primary",this.cancelButtonClasses="btn-default",this.locale={direction:"ltr",format:t.localeData().longDateFormat("L"),separator:" - ",applyLabel:"Apply",cancelLabel:"Cancel",weekLabel:"W",customRangeLabel:"Custom Range",daysOfWeek:t.weekdaysMin(),monthNames:t.monthsShort(),firstDay:t.localeData().firstDayOfWeek()},this.callback=function(){},this.isShowing=!1,this.leftCalendar={},this.rightCalendar={},"object"==typeof i&&null!==i||(i={}),"string"==typeof(i=e.extend(this.element.data(),i)).template||i.template instanceof e||(i.template='
'),this.parentEl=i.parentEl&&e(i.parentEl).length?e(i.parentEl):e(this.parentEl),this.container=e(i.template).appendTo(this.parentEl),"object"==typeof i.locale&&("string"==typeof i.locale.direction&&(this.locale.direction=i.locale.direction),"string"==typeof i.locale.format&&(this.locale.format=i.locale.format),"string"==typeof i.locale.separator&&(this.locale.separator=i.locale.separator),"object"==typeof i.locale.daysOfWeek&&(this.locale.daysOfWeek=i.locale.daysOfWeek.slice()),"object"==typeof i.locale.monthNames&&(this.locale.monthNames=i.locale.monthNames.slice()),"number"==typeof i.locale.firstDay&&(this.locale.firstDay=i.locale.firstDay),"string"==typeof i.locale.applyLabel&&(this.locale.applyLabel=i.locale.applyLabel),"string"==typeof i.locale.cancelLabel&&(this.locale.cancelLabel=i.locale.cancelLabel),"string"==typeof i.locale.weekLabel&&(this.locale.weekLabel=i.locale.weekLabel),"string"==typeof i.locale.customRangeLabel)){(f=document.createElement("textarea")).innerHTML=i.locale.customRangeLabel;var n=f.value;this.locale.customRangeLabel=n}if(this.container.addClass(this.locale.direction),"string"==typeof i.startDate&&(this.startDate=t(i.startDate,this.locale.format)),"string"==typeof i.endDate&&(this.endDate=t(i.endDate,this.locale.format)),"string"==typeof i.minDate&&(this.minDate=t(i.minDate,this.locale.format)),"string"==typeof i.maxDate&&(this.maxDate=t(i.maxDate,this.locale.format)),"object"==typeof i.startDate&&(this.startDate=t(i.startDate)),"object"==typeof i.endDate&&(this.endDate=t(i.endDate)),"object"==typeof i.minDate&&(this.minDate=t(i.minDate)),"object"==typeof i.maxDate&&(this.maxDate=t(i.maxDate)),this.minDate&&this.startDate.isBefore(this.minDate)&&(this.startDate=this.minDate.clone()),this.maxDate&&this.endDate.isAfter(this.maxDate)&&(this.endDate=this.maxDate.clone()),"string"==typeof i.applyButtonClasses&&(this.applyButtonClasses=i.applyButtonClasses),"string"==typeof i.applyClass&&(this.applyButtonClasses=i.applyClass),"string"==typeof i.cancelButtonClasses&&(this.cancelButtonClasses=i.cancelButtonClasses),"string"==typeof i.cancelClass&&(this.cancelButtonClasses=i.cancelClass),"object"==typeof i.maxSpan&&(this.maxSpan=i.maxSpan),"object"==typeof i.dateLimit&&(this.maxSpan=i.dateLimit),"string"==typeof i.opens&&(this.opens=i.opens),"string"==typeof i.drops&&(this.drops=i.drops),"boolean"==typeof i.showWeekNumbers&&(this.showWeekNumbers=i.showWeekNumbers),"boolean"==typeof i.showISOWeekNumbers&&(this.showISOWeekNumbers=i.showISOWeekNumbers),"string"==typeof i.buttonClasses&&(this.buttonClasses=i.buttonClasses),"object"==typeof i.buttonClasses&&(this.buttonClasses=i.buttonClasses.join(" ")),"boolean"==typeof i.showDropdowns&&(this.showDropdowns=i.showDropdowns),"number"==typeof i.minYear&&(this.minYear=i.minYear),"number"==typeof i.maxYear&&(this.maxYear=i.maxYear),"boolean"==typeof i.showCustomRangeLabel&&(this.showCustomRangeLabel=i.showCustomRangeLabel),"boolean"==typeof i.singleDatePicker&&(this.singleDatePicker=i.singleDatePicker,this.singleDatePicker&&(this.endDate=this.startDate.clone())),"boolean"==typeof i.timePicker&&(this.timePicker=i.timePicker),"boolean"==typeof i.timePickerSeconds&&(this.timePickerSeconds=i.timePickerSeconds),"number"==typeof i.timePickerIncrement&&(this.timePickerIncrement=i.timePickerIncrement),"boolean"==typeof i.timePicker24Hour&&(this.timePicker24Hour=i.timePicker24Hour),"boolean"==typeof i.autoApply&&(this.autoApply=i.autoApply),"boolean"==typeof i.autoUpdateInput&&(this.autoUpdateInput=i.autoUpdateInput),"boolean"==typeof i.linkedCalendars&&(this.linkedCalendars=i.linkedCalendars),"function"==typeof i.isInvalidDate&&(this.isInvalidDate=i.isInvalidDate),"function"==typeof i.isCustomDate&&(this.isCustomDate=i.isCustomDate),"boolean"==typeof i.alwaysShowCalendars&&(this.alwaysShowCalendars=i.alwaysShowCalendars),0!=this.locale.firstDay)for(var r=this.locale.firstDay;r>0;)this.locale.daysOfWeek.push(this.locale.daysOfWeek.shift()),r--;var o,l,h;if(void 0===i.startDate&&void 0===i.endDate&&e(this.element).is(":text")){var c=e(this.element).val(),d=c.split(this.locale.separator);o=l=null,2==d.length?(o=t(d[0],this.locale.format),l=t(d[1],this.locale.format)):this.singleDatePicker&&""!==c&&(o=t(c,this.locale.format),l=t(c,this.locale.format)),null!==o&&null!==l&&(this.setStartDate(o),this.setEndDate(l))}if("object"==typeof i.ranges){for(h in i.ranges){o="string"==typeof i.ranges[h][0]?t(i.ranges[h][0],this.locale.format):t(i.ranges[h][0]),l="string"==typeof i.ranges[h][1]?t(i.ranges[h][1],this.locale.format):t(i.ranges[h][1]),this.minDate&&o.isBefore(this.minDate)&&(o=this.minDate.clone());var m=this.maxDate;if(this.maxSpan&&m&&o.clone().add(this.maxSpan).isAfter(m)&&(m=o.clone().add(this.maxSpan)),m&&l.isAfter(m)&&(l=m.clone()),!(this.minDate&&l.isBefore(this.minDate,this.timepicker?"minute":"day")||m&&o.isAfter(m,this.timepicker?"minute":"day"))){var f;(f=document.createElement("textarea")).innerHTML=h;n=f.value;this.ranges[n]=[o,l]}}var p="";for(h in this.ranges)p+='- '+h+"
";this.showCustomRangeLabel&&(p+='- '+this.locale.customRangeLabel+"
"),p+="
",this.container.find(".ranges").prepend(p)}"function"==typeof s&&(this.callback=s),this.timePicker||(this.startDate=this.startDate.startOf("day"),this.endDate=this.endDate.endOf("day"),this.container.find(".calendar-time").hide()),this.timePicker&&this.autoApply&&(this.autoApply=!1),this.autoApply&&this.container.addClass("auto-apply"),"object"==typeof i.ranges&&this.container.addClass("show-ranges"),this.singleDatePicker&&(this.container.addClass("single"),this.container.find(".drp-calendar.left").addClass("single"),this.container.find(".drp-calendar.left").show(),this.container.find(".drp-calendar.right").hide(),this.timePicker||this.container.addClass("auto-apply")),(void 0===i.ranges&&!this.singleDatePicker||this.alwaysShowCalendars)&&this.container.addClass("show-calendar"),this.container.addClass("opens"+this.opens),this.container.find(".applyBtn, .cancelBtn").addClass(this.buttonClasses),this.applyButtonClasses.length&&this.container.find(".applyBtn").addClass(this.applyButtonClasses),this.cancelButtonClasses.length&&this.container.find(".cancelBtn").addClass(this.cancelButtonClasses),this.container.find(".applyBtn").html(this.locale.applyLabel),this.container.find(".cancelBtn").html(this.locale.cancelLabel),this.container.find(".drp-calendar").on("click.daterangepicker",".prev",e.proxy(this.clickPrev,this)).on("click.daterangepicker",".next",e.proxy(this.clickNext,this)).on("mousedown.daterangepicker","td.available",e.proxy(this.clickDate,this)).on("mouseenter.daterangepicker","td.available",e.proxy(this.hoverDate,this)).on("change.daterangepicker","select.yearselect",e.proxy(this.monthOrYearChanged,this)).on("change.daterangepicker","select.monthselect",e.proxy(this.monthOrYearChanged,this)).on("change.daterangepicker","select.hourselect,select.minuteselect,select.secondselect,select.ampmselect",e.proxy(this.timeChanged,this)),this.container.find(".ranges").on("click.daterangepicker","li",e.proxy(this.clickRange,this)),this.container.find(".drp-buttons").on("click.daterangepicker","button.applyBtn",e.proxy(this.clickApply,this)).on("click.daterangepicker","button.cancelBtn",e.proxy(this.clickCancel,this)),this.element.is("input")||this.element.is("button")?this.element.on({"click.daterangepicker":e.proxy(this.show,this),"focus.daterangepicker":e.proxy(this.show,this),"keyup.daterangepicker":e.proxy(this.elementChanged,this),"keydown.daterangepicker":e.proxy(this.keydown,this)}):(this.element.on("click.daterangepicker",e.proxy(this.toggle,this)),this.element.on("keydown.daterangepicker",e.proxy(this.toggle,this))),this.updateElement()};return a.prototype={constructor:a,setStartDate:function(e){"string"==typeof e&&(this.startDate=t(e,this.locale.format)),"object"==typeof e&&(this.startDate=t(e)),this.timePicker||(this.startDate=this.startDate.startOf("day")),this.timePicker&&this.timePickerIncrement&&this.startDate.minute(Math.round(this.startDate.minute()/this.timePickerIncrement)*this.timePickerIncrement),this.minDate&&this.startDate.isBefore(this.minDate)&&(this.startDate=this.minDate.clone(),this.timePicker&&this.timePickerIncrement&&this.startDate.minute(Math.round(this.startDate.minute()/this.timePickerIncrement)*this.timePickerIncrement)),this.maxDate&&this.startDate.isAfter(this.maxDate)&&(this.startDate=this.maxDate.clone(),this.timePicker&&this.timePickerIncrement&&this.startDate.minute(Math.floor(this.startDate.minute()/this.timePickerIncrement)*this.timePickerIncrement)),this.isShowing||this.updateElement(),this.updateMonthsInView()},setEndDate:function(e){"string"==typeof e&&(this.endDate=t(e,this.locale.format)),"object"==typeof e&&(this.endDate=t(e)),this.timePicker||(this.endDate=this.endDate.endOf("day")),this.timePicker&&this.timePickerIncrement&&this.endDate.minute(Math.round(this.endDate.minute()/this.timePickerIncrement)*this.timePickerIncrement),this.endDate.isBefore(this.startDate)&&(this.endDate=this.startDate.clone()),this.maxDate&&this.endDate.isAfter(this.maxDate)&&(this.endDate=this.maxDate.clone()),this.maxSpan&&this.startDate.clone().add(this.maxSpan).isBefore(this.endDate)&&(this.endDate=this.startDate.clone().add(this.maxSpan)),this.previousRightTime=this.endDate.clone(),this.container.find(".drp-selected").html(this.startDate.format(this.locale.format)+this.locale.separator+this.endDate.format(this.locale.format)),this.isShowing||this.updateElement(),this.updateMonthsInView()},isInvalidDate:function(){return!1},isCustomDate:function(){return!1},updateView:function(){this.timePicker&&(this.renderTimePicker("left"),this.renderTimePicker("right"),this.endDate?this.container.find(".right .calendar-time select").removeAttr("disabled").removeClass("disabled"):this.container.find(".right .calendar-time select").attr("disabled","disabled").addClass("disabled")),this.endDate&&this.container.find(".drp-selected").html(this.startDate.format(this.locale.format)+this.locale.separator+this.endDate.format(this.locale.format)),this.updateMonthsInView(),this.updateCalendars(),this.updateFormInputs()},updateMonthsInView:function(){if(this.endDate){if(!this.singleDatePicker&&this.leftCalendar.month&&this.rightCalendar.month&&(this.startDate.format("YYYY-MM")==this.leftCalendar.month.format("YYYY-MM")||this.startDate.format("YYYY-MM")==this.rightCalendar.month.format("YYYY-MM"))&&(this.endDate.format("YYYY-MM")==this.leftCalendar.month.format("YYYY-MM")||this.endDate.format("YYYY-MM")==this.rightCalendar.month.format("YYYY-MM")))return;this.leftCalendar.month=this.startDate.clone().date(2),this.linkedCalendars||this.endDate.month()==this.startDate.month()&&this.endDate.year()==this.startDate.year()?this.rightCalendar.month=this.startDate.clone().date(2).add(1,"month"):this.rightCalendar.month=this.endDate.clone().date(2)}else this.leftCalendar.month.format("YYYY-MM")!=this.startDate.format("YYYY-MM")&&this.rightCalendar.month.format("YYYY-MM")!=this.startDate.format("YYYY-MM")&&(this.leftCalendar.month=this.startDate.clone().date(2),this.rightCalendar.month=this.startDate.clone().date(2).add(1,"month"));this.maxDate&&this.linkedCalendars&&!this.singleDatePicker&&this.rightCalendar.month>this.maxDate&&(this.rightCalendar.month=this.maxDate.clone().date(2),this.leftCalendar.month=this.maxDate.clone().date(2).subtract(1,"month"))},updateCalendars:function(){if(this.timePicker){var t,e,a,i;if(this.endDate){if(t=parseInt(this.container.find(".left .hourselect").val(),10),e=parseInt(this.container.find(".left .minuteselect").val(),10),isNaN(e)&&(e=parseInt(this.container.find(".left .minuteselect option:last").val(),10)),a=this.timePickerSeconds?parseInt(this.container.find(".left .secondselect").val(),10):0,!this.timePicker24Hour)"PM"===(i=this.container.find(".left .ampmselect").val())&&t<12&&(t+=12),"AM"===i&&12===t&&(t=0)}else if(t=parseInt(this.container.find(".right .hourselect").val(),10),e=parseInt(this.container.find(".right .minuteselect").val(),10),isNaN(e)&&(e=parseInt(this.container.find(".right .minuteselect option:last").val(),10)),a=this.timePickerSeconds?parseInt(this.container.find(".right .secondselect").val(),10):0,!this.timePicker24Hour)"PM"===(i=this.container.find(".right .ampmselect").val())&&t<12&&(t+=12),"AM"===i&&12===t&&(t=0);this.leftCalendar.month.hour(t).minute(e).second(a),this.rightCalendar.month.hour(t).minute(e).second(a)}this.renderCalendar("left"),this.renderCalendar("right"),this.container.find(".ranges li").removeClass("active"),null!=this.endDate&&this.calculateChosenLabel()},renderCalendar:function(a){var i,s=(i="left"==a?this.leftCalendar:this.rightCalendar).month.month(),n=i.month.year(),r=i.month.hour(),o=i.month.minute(),l=i.month.second(),h=t([n,s]).daysInMonth(),c=t([n,s,1]),d=t([n,s,h]),m=t(c).subtract(1,"month").month(),f=t(c).subtract(1,"month").year(),p=t([f,m]).daysInMonth(),u=c.day();(i=[]).firstDay=c,i.lastDay=d;for(var D=0;D<6;D++)i[D]=[];var g=p-u+this.locale.firstDay+1;g>p&&(g-=7),u==this.locale.firstDay&&(g=p-6);for(var y=t([f,m,g,12,o,l]),k=(D=0,0),b=0;D<42;D++,k++,y=t(y).add(24,"hour"))D>0&&k%7==0&&(k=0,b++),i[b][k]=y.clone().hour(r).minute(o).second(l),y.hour(12),this.minDate&&i[b][k].format("YYYY-MM-DD")==this.minDate.format("YYYY-MM-DD")&&i[b][k].isBefore(this.minDate)&&"left"==a&&(i[b][k]=this.minDate.clone()),this.maxDate&&i[b][k].format("YYYY-MM-DD")==this.maxDate.format("YYYY-MM-DD")&&i[b][k].isAfter(this.maxDate)&&"right"==a&&(i[b][k]=this.maxDate.clone());"left"==a?this.leftCalendar.calendar=i:this.rightCalendar.calendar=i;var v="left"==a?this.minDate:this.startDate,C=this.maxDate,Y=("left"==a?this.startDate:this.endDate,this.locale.direction,'');Y+="",Y+="",(this.showWeekNumbers||this.showISOWeekNumbers)&&(Y+=" | "),v&&!v.isBefore(i.firstDay)||this.linkedCalendars&&"left"!=a?Y+=" | ":Y+=' | ';var w=this.locale.monthNames[i[1][1].month()]+i[1][1].format(" YYYY");if(this.showDropdowns){for(var P=i[1][1].month(),x=i[1][1].year(),M=C&&C.year()||this.maxYear,I=v&&v.year()||this.minYear,S=x==I,B=x==M,A='";for(var N='")}if(Y+=''+w+" | ",C&&!C.isAfter(i.lastDay)||this.linkedCalendars&&"right"!=a&&!this.singleDatePicker?Y+=" | ":Y+=' | ',Y+="
",Y+="",(this.showWeekNumbers||this.showISOWeekNumbers)&&(Y+='| '+this.locale.weekLabel+" | "),e.each(this.locale.daysOfWeek,function(t,e){Y+=""+e+" | "}),Y+="
",Y+="",Y+="",null==this.endDate&&this.maxSpan){var W=this.startDate.clone().add(this.maxSpan).endOf("day");C&&!W.isBefore(C)||(C=W)}for(b=0;b<6;b++){Y+="",this.showWeekNumbers?Y+='| '+i[b][0].week()+" | ":this.showISOWeekNumbers&&(Y+=''+i[b][0].isoWeek()+" | ");for(k=0;k<7;k++){var O=[];i[b][k].isSame(new Date,"day")&&O.push("today"),i[b][k].isoWeekday()>5&&O.push("weekend"),i[b][k].month()!=i[1][1].month()&&O.push("off","ends"),this.minDate&&i[b][k].isBefore(this.minDate,"day")&&O.push("off","disabled"),C&&i[b][k].isAfter(C,"day")&&O.push("off","disabled"),this.isInvalidDate(i[b][k])&&O.push("off","disabled"),i[b][k].format("YYYY-MM-DD")==this.startDate.format("YYYY-MM-DD")&&O.push("active","start-date"),null!=this.endDate&&i[b][k].format("YYYY-MM-DD")==this.endDate.format("YYYY-MM-DD")&&O.push("active","end-date"),null!=this.endDate&&i[b][k]>this.startDate&&i[b][k]'+i[b][k].date()+""}Y+="
"}Y+="",Y+="
",this.container.find(".drp-calendar."+a+" .calendar-table").html(Y)},renderTimePicker:function(t){if("right"!=t||this.endDate){var e,a,i,s=this.maxDate;if(!this.maxSpan||this.maxDate&&!this.startDate.clone().add(this.maxSpan).isBefore(this.maxDate)||(s=this.startDate.clone().add(this.maxSpan)),"left"==t)a=this.startDate.clone(),i=this.minDate;else if("right"==t){a=this.endDate.clone(),i=this.startDate;var n=this.container.find(".drp-calendar.right .calendar-time");if(""!=n.html()&&(a.hour(isNaN(a.hour())?n.find(".hourselect option:selected").val():a.hour()),a.minute(isNaN(a.minute())?n.find(".minuteselect option:selected").val():a.minute()),a.second(isNaN(a.second())?n.find(".secondselect option:selected").val():a.second()),!this.timePicker24Hour)){var r=n.find(".ampmselect option:selected").val();"PM"===r&&a.hour()<12&&a.hour(a.hour()+12),"AM"===r&&12===a.hour()&&a.hour(0)}a.isBefore(this.startDate)&&(a=this.startDate.clone()),s&&a.isAfter(s)&&(a=s.clone())}e=' ",e+=': ",this.timePickerSeconds){e+=': "}if(!this.timePicker24Hour){e+='"}this.container.find(".drp-calendar."+t+" .calendar-time").html(e)}},updateFormInputs:function(){this.singleDatePicker||this.endDate&&(this.startDate.isBefore(this.endDate)||this.startDate.isSame(this.endDate))?this.container.find("button.applyBtn").removeAttr("disabled"):this.container.find("button.applyBtn").attr("disabled","disabled")},move:function(){var t,a={top:0,left:0},i=e(window).width();this.parentEl.is("body")||(a={top:this.parentEl.offset().top-this.parentEl.scrollTop(),left:this.parentEl.offset().left-this.parentEl.scrollLeft()},i=this.parentEl[0].clientWidth+this.parentEl.offset().left),t="up"==this.drops?this.element.offset().top-this.container.outerHeight()-a.top:this.element.offset().top+this.element.outerHeight()-a.top,this.container.css({top:0,left:0,right:"auto"});var s=this.container.outerWidth();if(this.container["up"==this.drops?"addClass":"removeClass"]("drop-up"),"left"==this.opens){var n=i-this.element.offset().left-this.element.outerWidth();s+n>e(window).width()?this.container.css({top:t,right:"auto",left:9}):this.container.css({top:t,right:n,left:"auto"})}else if("center"==this.opens){(r=this.element.offset().left-a.left+this.element.outerWidth()/2-s/2)<0?this.container.css({top:t,right:"auto",left:9}):r+s>e(window).width()?this.container.css({top:t,left:"auto",right:0}):this.container.css({top:t,left:r,right:"auto"})}else{var r;(r=this.element.offset().left-a.left)+s>e(window).width()?this.container.css({top:t,left:"auto",right:0}):this.container.css({top:t,left:r,right:"auto"})}},show:function(t){this.isShowing||(this._outsideClickProxy=e.proxy(function(t){this.outsideClick(t)},this),e(document).on("mousedown.daterangepicker",this._outsideClickProxy).on("touchend.daterangepicker",this._outsideClickProxy).on("click.daterangepicker","[data-toggle=dropdown]",this._outsideClickProxy).on("focusin.daterangepicker",this._outsideClickProxy),e(window).on("resize.daterangepicker",e.proxy(function(t){this.move(t)},this)),this.oldStartDate=this.startDate.clone(),this.oldEndDate=this.endDate.clone(),this.previousRightTime=this.endDate.clone(),this.updateView(),this.container.show(),this.move(),this.element.trigger("show.daterangepicker",this),this.isShowing=!0)},hide:function(t){this.isShowing&&(this.endDate||(this.startDate=this.oldStartDate.clone(),this.endDate=this.oldEndDate.clone()),this.startDate.isSame(this.oldStartDate)&&this.endDate.isSame(this.oldEndDate)||this.callback(this.startDate.clone(),this.endDate.clone(),this.chosenLabel),this.updateElement(),e(document).off(".daterangepicker"),e(window).off(".daterangepicker"),this.container.hide(),this.element.trigger("hide.daterangepicker",this),this.isShowing=!1)},toggle:function(t){this.isShowing?this.hide():this.show()},outsideClick:function(t){var a=e(t.target);"focusin"==t.type||a.closest(this.element).length||a.closest(this.container).length||a.closest(".calendar-table").length||(this.hide(),this.element.trigger("outsideClick.daterangepicker",this))},showCalendars:function(){this.container.addClass("show-calendar"),this.move(),this.element.trigger("showCalendar.daterangepicker",this)},hideCalendars:function(){this.container.removeClass("show-calendar"),this.element.trigger("hideCalendar.daterangepicker",this)},clickRange:function(t){var e=t.target.getAttribute("data-range-key");if(this.chosenLabel=e,e==this.locale.customRangeLabel)this.showCalendars();else{var a=this.ranges[e];this.startDate=a[0],this.endDate=a[1],this.timePicker||(this.startDate.startOf("day"),this.endDate.endOf("day")),this.alwaysShowCalendars||this.hideCalendars(),this.clickApply()}},clickPrev:function(t){e(t.target).parents(".drp-calendar").hasClass("left")?(this.leftCalendar.month.subtract(1,"month"),this.linkedCalendars&&this.rightCalendar.month.subtract(1,"month")):this.rightCalendar.month.subtract(1,"month"),this.updateCalendars()},clickNext:function(t){e(t.target).parents(".drp-calendar").hasClass("left")?this.leftCalendar.month.add(1,"month"):(this.rightCalendar.month.add(1,"month"),this.linkedCalendars&&this.leftCalendar.month.add(1,"month")),this.updateCalendars()},hoverDate:function(t){if(e(t.target).hasClass("available")){var a=e(t.target).attr("data-title"),i=a.substr(1,1),s=a.substr(3,1),n=e(t.target).parents(".drp-calendar").hasClass("left")?this.leftCalendar.calendar[i][s]:this.rightCalendar.calendar[i][s],r=this.leftCalendar,o=this.rightCalendar,l=this.startDate;this.endDate||this.container.find(".drp-calendar tbody td").each(function(t,a){if(!e(a).hasClass("week")){var i=e(a).attr("data-title"),s=i.substr(1,1),h=i.substr(3,1),c=e(a).parents(".drp-calendar").hasClass("left")?r.calendar[s][h]:o.calendar[s][h];c.isAfter(l)&&c.isBefore(n)||c.isSame(n,"day")?e(a).addClass("in-range"):e(a).removeClass("in-range")}})}},clickDate:function(t){if(e(t.target).hasClass("available")){var a=e(t.target).attr("data-title"),i=a.substr(1,1),s=a.substr(3,1),n=e(t.target).parents(".drp-calendar").hasClass("left")?this.leftCalendar.calendar[i][s]:this.rightCalendar.calendar[i][s];if(this.endDate||n.isBefore(this.startDate,"day")){if(this.timePicker){var r=parseInt(this.container.find(".left .hourselect").val(),10);if(!this.timePicker24Hour)"PM"===(h=this.container.find(".left .ampmselect").val())&&r<12&&(r+=12),"AM"===h&&12===r&&(r=0);var o=parseInt(this.container.find(".left .minuteselect").val(),10);isNaN(o)&&(o=parseInt(this.container.find(".left .minuteselect option:last").val(),10));var l=this.timePickerSeconds?parseInt(this.container.find(".left .secondselect").val(),10):0;n=n.clone().hour(r).minute(o).second(l)}this.endDate=null,this.setStartDate(n.clone())}else if(!this.endDate&&n.isBefore(this.startDate))this.setEndDate(this.startDate.clone());else{if(this.timePicker){var h;r=parseInt(this.container.find(".right .hourselect").val(),10);if(!this.timePicker24Hour)"PM"===(h=this.container.find(".right .ampmselect").val())&&r<12&&(r+=12),"AM"===h&&12===r&&(r=0);o=parseInt(this.container.find(".right .minuteselect").val(),10);isNaN(o)&&(o=parseInt(this.container.find(".right .minuteselect option:last").val(),10));l=this.timePickerSeconds?parseInt(this.container.find(".right .secondselect").val(),10):0;n=n.clone().hour(r).minute(o).second(l)}this.setEndDate(n.clone()),this.autoApply&&(this.calculateChosenLabel(),this.clickApply())}this.singleDatePicker&&(this.setEndDate(this.startDate),this.timePicker||this.clickApply()),this.updateView(),t.stopPropagation()}},calculateChosenLabel:function(){var t=!0,e=0;for(var a in this.ranges){if(this.timePicker){var i=this.timePickerSeconds?"YYYY-MM-DD HH:mm:ss":"YYYY-MM-DD HH:mm";if(this.startDate.format(i)==this.ranges[a][0].format(i)&&this.endDate.format(i)==this.ranges[a][1].format(i)){t=!1,this.chosenLabel=this.container.find(".ranges li:eq("+e+")").addClass("active").attr("data-range-key");break}}else if(this.startDate.format("YYYY-MM-DD")==this.ranges[a][0].format("YYYY-MM-DD")&&this.endDate.format("YYYY-MM-DD")==this.ranges[a][1].format("YYYY-MM-DD")){t=!1,this.chosenLabel=this.container.find(".ranges li:eq("+e+")").addClass("active").attr("data-range-key");break}e++}t&&(this.showCustomRangeLabel?this.chosenLabel=this.container.find(".ranges li:last").addClass("active").attr("data-range-key"):this.chosenLabel=null,this.showCalendars())},clickApply:function(t){this.hide(),this.element.trigger("apply.daterangepicker",this)},clickCancel:function(t){this.startDate=this.oldStartDate,this.endDate=this.oldEndDate,this.hide(),this.element.trigger("cancel.daterangepicker",this)},monthOrYearChanged:function(t){var a=e(t.target).closest(".drp-calendar").hasClass("left"),i=a?"left":"right",s=this.container.find(".drp-calendar."+i),n=parseInt(s.find(".monthselect").val(),10),r=s.find(".yearselect").val();a||(rthis.maxDate.year()||r==this.maxDate.year()&&n>this.maxDate.month())&&(n=this.maxDate.month(),r=this.maxDate.year()),a?(this.leftCalendar.month.month(n).year(r),this.linkedCalendars&&(this.rightCalendar.month=this.leftCalendar.month.clone().add(1,"month"))):(this.rightCalendar.month.month(n).year(r),this.linkedCalendars&&(this.leftCalendar.month=this.rightCalendar.month.clone().subtract(1,"month"))),this.updateCalendars()},timeChanged:function(t){var a=e(t.target).closest(".drp-calendar"),i=a.hasClass("left"),s=parseInt(a.find(".hourselect").val(),10),n=parseInt(a.find(".minuteselect").val(),10);isNaN(n)&&(n=parseInt(a.find(".minuteselect option:last").val(),10));var r=this.timePickerSeconds?parseInt(a.find(".secondselect").val(),10):0;if(!this.timePicker24Hour){var o=a.find(".ampmselect").val();"PM"===o&&s<12&&(s+=12),"AM"===o&&12===s&&(s=0)}if(i){var l=this.startDate.clone();l.hour(s),l.minute(n),l.second(r),this.setStartDate(l),this.singleDatePicker?this.endDate=this.startDate.clone():this.endDate&&this.endDate.format("YYYY-MM-DD")==l.format("YYYY-MM-DD")&&this.endDate.isBefore(l)&&this.setEndDate(l.clone())}else if(this.endDate){var h=this.endDate.clone();h.hour(s),h.minute(n),h.second(r),this.setEndDate(h)}this.updateCalendars(),this.updateFormInputs(),this.renderTimePicker("left"),this.renderTimePicker("right")},elementChanged:function(){if(this.element.is("input")&&this.element.val().length){var e=this.element.val().split(this.locale.separator),a=null,i=null;2===e.length&&(a=t(e[0],this.locale.format),i=t(e[1],this.locale.format)),(this.singleDatePicker||null===a||null===i)&&(i=a=t(this.element.val(),this.locale.format)),a.isValid()&&i.isValid()&&(this.setStartDate(a),this.setEndDate(i),this.updateView())}},keydown:function(t){9!==t.keyCode&&13!==t.keyCode||this.hide(),27===t.keyCode&&(t.preventDefault(),t.stopPropagation(),this.hide())},updateElement:function(){if(this.element.is("input")&&this.autoUpdateInput){var t=this.startDate.format(this.locale.format);this.singleDatePicker||(t+=this.locale.separator+this.endDate.format(this.locale.format)),t!==this.element.val()&&this.element.val(t).trigger("change")}},remove:function(){this.container.remove(),this.element.off(".daterangepicker"),this.element.removeData()}},e.fn.daterangepicker=function(t,i){var s=e.extend(!0,{},e.fn.daterangepicker.defaultOptions,t);return this.each(function(){var t=e(this);t.data("daterangepicker")&&t.data("daterangepicker").remove(),t.data("daterangepicker",new a(t,s,i))}),this},a});
//# sourceMappingURL=/sm/3a884fe0bdb97cb3a94b410e67cf38fdc248890d5581232077b3e6241e25cd21.map;
// source --> https://www.slovacko.cz/wp-content/themes/slovacko_theme/js/animatedModal.js?ver=5.2.7
/*=========================================
* animatedModal.js: Version 1.0
* author: João Pereira
* website: https://joaopereira.pt
* email: joaopereirawd@gmail.com
* Licensed MIT
=========================================*/
(function ($) {
$.fn.animatedModal = function(options) {
var modal = $(this);
//Defaults
var settings = $.extend({
modalTarget: modal.attr('href').replace('#',''),
position:'fixed',
width:'100%',
height:'100%',
top:'0px',
left:'0px',
zIndexIn: '9999',
zIndexOut: '-9999',
color: '#39BEB9',
opacityIn:'1',
opacityOut:'0',
animatedIn:'zoomIn',
animatedOut:'zoomOut',
animationDuration:'.6s',
overflow:'auto',
// Callbacks
beforeOpen: function() {},
afterOpen: function() {},
beforeClose: function() {},
afterClose: function() {}
}, options);
var closeBt = $('.close-'+settings.modalTarget);
//console.log(closeBt)
var href = $(modal).attr('href'),
id = $('body').find('#'+settings.modalTarget),
idConc = '#'+id.attr('id');
//console.log(idConc);
// Default Classes
id.addClass('animated');
id.addClass(settings.modalTarget+'-off');
//Init styles
var initStyles = {
'position':settings.position,
'width':settings.width,
'height':settings.height,
'top':settings.top,
'left':settings.left,
'background-color':settings.color,
'overflow-y':settings.overflow,
'z-index':settings.zIndexOut,
'opacity':settings.opacityOut,
'-webkit-animation-duration':settings.animationDuration,
'-moz-animation-duration':settings.animationDuration,
'-ms-animation-duration':settings.animationDuration,
'animation-duration':settings.animationDuration
};
//Apply stles
id.css(initStyles);
modal.click(function(event) {
event.preventDefault();
$('body, html').css({'overflow':'hidden'});
if (href == idConc) {
if (id.hasClass(settings.modalTarget+'-off')) {
id.removeClass(settings.animatedOut);
id.removeClass(settings.modalTarget+'-off');
id.addClass(settings.modalTarget+'-on');
}
if (id.hasClass(settings.modalTarget+'-on')) {
settings.beforeOpen();
id.css({'opacity':settings.opacityIn,'z-index':settings.zIndexIn});
id.addClass(settings.animatedIn);
id.one('webkitAnimationEnd mozAnimationEnd MSAnimationEnd oanimationend animationend', afterOpen);
};
}
});
closeBt.click(function(event) {
event.preventDefault();
$('body, html').css({'overflow':'auto'});
settings.beforeClose(); //beforeClose
if (id.hasClass(settings.modalTarget+'-on')) {
id.removeClass(settings.modalTarget+'-on');
id.addClass(settings.modalTarget+'-off');
}
if (id.hasClass(settings.modalTarget+'-off')) {
id.removeClass(settings.animatedIn);
id.addClass(settings.animatedOut);
id.one('webkitAnimationEnd mozAnimationEnd MSAnimationEnd oanimationend animationend', afterClose);
};
});
function afterClose () {
id.css({'z-index':settings.zIndexOut});
settings.afterClose(); //afterClose
}
function afterOpen () {
settings.afterOpen(); //afterOpen
}
}; // End animatedModal.js
}(jQuery));
// source --> https://www.slovacko.cz/wp-content/themes/slovacko_theme/js/acfmap.js?v=2&ver=5.2.7
var globalinfowindow = null;
// (function ($) {
/*
* new_map
*
* This function will render a Google Map onto the selected jQuery element
*
* @type function
* @date 8/11/2013
* @since 4.3.0
*
* @param $el (jQuery element)
* @return n/a
*/
function new_map($el) {
console.log('NEW MAP78')
// var
var $markers = $el.find('.marker');
// vars
var args = {
zoom: 16,
center: new google.maps.LatLng(0, 0),
mapTypeId: google.maps.MapTypeId.ROADMAP,
controlSize: 25
};
// create map
var map = new google.maps.Map($el[0], args);
// add a markers reference
map.markers = [];
// add markers
$markers.each(function() {
add_marker($(this), map);
});
// center map
center_map(map);
// return
return map;
}
/*
* add_marker
*
* This function will add a marker to the selected Google Map
*
* @type function
* @date 8/11/2013
* @since 4.3.0
*
* @param $marker (jQuery element)
* @param map (Google Map object)
* @return n/a
*/
function add_marker($marker, map) {
// console.log('ADD MARKER')
// var
var latlng = new google.maps.LatLng($marker.attr('data-lat'), $marker.attr('data-lng'));
var typ = $marker.attr('data-type');
var icon = 'mapr.svg';
if (typ == 'gastro') {
icon = 'mapb.svg'
}
if (typ == 'ubytovani') {
icon = 'mapg.svg'
}
if (typ == 'akce') {
icon = 'mapy.svg'
}
var iconconf = {
url: $('body').data('themelink') + '/images/' + icon, // url
// scaledSize: new google.maps.Size(43, 53), // scaled size
scaledSize: new google.maps.Size(32, 40), // scaled size
// origin: new google.maps.Point(0, 0), // origin
anchor: new google.maps.Point(16, 40) // anchor
};
// create marker
var marker = new google.maps.Marker({
position: latlng,
map: map,
icon: iconconf,
link: $marker.attr('data-link'),
type: typ,
});
// add to array
map.markers.push(marker);
// if marker contains HTML, add it to an infoWindow
if ($marker.html()) {
// create info window
var infowindow = new google.maps.InfoWindow({
content: $marker.html()
});
// if ($(window).width() > 992) {
// show info window when marker is clicked
// google.maps.event.addListener(marker, 'mouseover', function () {
// infowindow.open(map, marker);
// });
// google.maps.event.addListener(marker, 'mouseout', function () {
// infowindow.close(map, marker);
// });
// google.maps.event.addListener(marker, 'click', function () {
// console.log(marker.link);
// console.log($(marker.link));
// $('.infodetail').hide()
// $(marker.link).show()
// $('.acf-map').addClass('openinfo');
// });
// }else{
google.maps.event.addListener(marker, 'mousedown', function() {
if (globalinfowindow) {
globalinfowindow.close();
}
infowindow.open(map, marker);
globalinfowindow = infowindow;
setTimeout(function() {
initlazyload()
}, 250)
});
// }
}
}
/*
* center_map
*
* This function will center the map, showing all markers attached to this map
*
* @type function
* @date 8/11/2013
* @since 4.3.0
*
* @param map (Google Map object)
* @return n/a
*/
function center_map(map) {
console.log('CENTER MAP')
// vars
var bounds = new google.maps.LatLngBounds();
// loop through all markers and create bounds
$.each(map.markers, function(i, marker) {
var latlng = new google.maps.LatLng(marker.position.lat(), marker.position.lng());
bounds.extend(latlng);
});
// only 1 marker?
if (map.markers.length == 1) {
// set center of map
map.setCenter(bounds.getCenter());
map.setZoom(12);
} else {
// fit to bounds
map.fitBounds(bounds);
}
}
/*
* document ready
*
* This function will render each map when the document is ready (page has loaded)
*
* @type function
* @date 8/11/2013
* @since 5.0.0
*
* @param n/a
* @return n/a
*/
$(document).ready(function() {
$('.acf-map.initnow').each(function() {
// create map
map = new_map($(this));
});
});
// })(jQuery);
function initmaplazy() {
$('.acf-map.initlazy').each(function() {
$(this).css("display", 'block');
// create map
map = new_map($(this));
});
}
// global var
var map = null;
filterMarkers = function(visibletypes) {
console.log('FILTER MARKER - cykle')
for (i = 0; i < map.markers.length; i++) {
marker = map.markers[i];
// If is same category or category not picked
if (visibletypes.indexOf(marker.type) != -1) {
marker.setVisible(true);
} else {
marker.setVisible(false);
}
}
};
// source --> https://www.slovacko.cz/wp-content/themes/slovacko_theme/js/lazyload.min.js?ver=5.2.7
function _extends(){return(_extends=Object.assign||function(t){for(var e=1;e-1&&(I(t,e),h(t,o.class_loading)),b(t,e),function(t){s(t,"was-processed","true")}(t),d(o.callback_reveal,t),d(o.callback_set,t))},O=function(t){return!!n&&(t._observer=new IntersectionObserver(function(e){e.forEach(function(e){return function(t){return t.isIntersecting||t.intersectionRatio>0}(e)?function(t,e){var n=e._settings;d(n.callback_enter,t),n.load_delay?x(t,e):A(t,e)}(e.target,t):function(t,e){var n=e._settings;d(n.callback_exit,t),n.load_delay&&L(t)}(e.target,t)})},{root:(e=t._settings).container===document?null:e.container,rootMargin:e.thresholds||e.threshold+"px"}),!0);var e},N=["IMG","IFRAME"],C=function(t,e){return function(t){return t.filter(function(t){return!c(t)})}((n=t||function(t){return t.container.querySelectorAll(t.elements_selector)}(e),Array.prototype.slice.call(n)));var n},M=function(t,e){this._settings=function(t){return _extends({},r,t)}(t),this._loadingCount=0,O(this),this.update(e)};return M.prototype={update:function(t){var n,o=this,r=this._settings;(this._elements=C(t,r),!e&&this._observer)?(function(t){return t.use_native&&"loading"in HTMLImageElement.prototype}(r)&&((n=this)._elements.forEach(function(t){-1!==N.indexOf(t.tagName)&&(t.setAttribute("loading","lazy"),z(t,n))}),this._elements=C(t,r)),this._elements.forEach(function(t){o._observer.observe(t)})):this.loadAll()},destroy:function(){var t=this;this._observer&&(this._elements.forEach(function(e){t._observer.unobserve(e)}),this._observer=null),this._elements=null,this._settings=null},load:function(t,e){z(t,this,e)},loadAll:function(){var t=this;this._elements.forEach(function(e){A(e,t)})}},t&&function(t,e){if(e)if(e.length)for(var n,o=0;n=e[o];o+=1)a(t,n);else a(t,e)}(M,window.lazyLoadOptions),M});
//# sourceMappingURL=lazyload.min.js.map;
// source --> https://www.slovacko.cz/wp-content/themes/slovacko_theme/js/jquery.nicescroll.js?ver=5.2.7
/* jquery.nicescroll
-- version 3.7.6
-- copyright 2017-07-19 InuYaksa*2017
-- licensed under the MIT
--
-- https://nicescroll.areaaperta.com/
-- https://github.com/inuyaksa/jquery.nicescroll
--
*/
/* jshint expr: true */
(function (factory) {
if (typeof define === 'function' && define.amd) {
// AMD. Register as anonymous module.
define(['jquery'], factory);
} else if (typeof exports === 'object') {
// Node/CommonJS.
module.exports = factory(require('jquery'));
} else {
// Browser globals.
factory(jQuery);
}
}(function (jQuery) {
"use strict";
// globals
var domfocus = false,
mousefocus = false,
tabindexcounter = 0,
ascrailcounter = 2000,
globalmaxzindex = 0;
var $ = jQuery, // sandbox
_doc = document,
_win = window,
$window = $(_win);
var delegatevents = [];
// http://stackoverflow.com/questions/2161159/get-script-path
function getScriptPath() {
var scripts = _doc.currentScript || (function () { var s = _doc.getElementsByTagName('script'); return (s.length) ? s[s.length - 1] : false; })();
var path = scripts ? scripts.src.split('?')[0] : '';
return (path.split('/').length > 0) ? path.split('/').slice(0, -1).join('/') + '/' : '';
}
// based on code by Paul Irish https://www.paulirish.com/2011/requestanimationframe-for-smart-animating/
var setAnimationFrame = _win.requestAnimationFrame || _win.webkitRequestAnimationFrame || _win.mozRequestAnimationFrame || false;
var clearAnimationFrame = _win.cancelAnimationFrame || _win.webkitCancelAnimationFrame || _win.mozCancelAnimationFrame || false;
if (!setAnimationFrame) {
var anilasttime = 0;
setAnimationFrame = function (callback, element) {
var currTime = new Date().getTime();
var timeToCall = Math.max(0, 16 - (currTime - anilasttime));
var id = _win.setTimeout(function () { callback(currTime + timeToCall); },
timeToCall);
anilasttime = currTime + timeToCall;
return id;
};
clearAnimationFrame = function (id) {
_win.clearTimeout(id);
};
} else {
if (!_win.cancelAnimationFrame) clearAnimationFrame = function (id) { };
}
var ClsMutationObserver = _win.MutationObserver || _win.WebKitMutationObserver || false;
var now = Date.now || function () { return new Date().getTime(); };
var _globaloptions = {
zindex: "auto",
cursoropacitymin: 0,
cursoropacitymax: 1,
cursorcolor: "#424242",
cursorwidth: "6px",
cursorborder: "1px solid #fff",
cursorborderradius: "5px",
scrollspeed: 40,
mousescrollstep: 9 * 3,
touchbehavior: false, // deprecated
emulatetouch: false, // replacing touchbehavior
hwacceleration: true,
usetransition: true,
boxzoom: false,
dblclickzoom: true,
gesturezoom: true,
grabcursorenabled: true,
autohidemode: true,
background: "",
iframeautoresize: true,
cursorminheight: 32,
preservenativescrolling: true,
railoffset: false,
railhoffset: false,
bouncescroll: true,
spacebarenabled: true,
railpadding: {
top: 0,
right: 0,
left: 0,
bottom: 0
},
disableoutline: true,
horizrailenabled: true,
railalign: "right",
railvalign: "bottom",
enabletranslate3d: true,
enablemousewheel: true,
enablekeyboard: true,
smoothscroll: true,
sensitiverail: true,
enablemouselockapi: true,
// cursormaxheight:false,
cursorfixedheight: false,
directionlockdeadzone: 6,
hidecursordelay: 400,
nativeparentscrolling: true,
enablescrollonselection: true,
overflowx: true,
overflowy: true,
cursordragspeed: 0.3,
rtlmode: "auto",
cursordragontouch: false,
oneaxismousemode: "auto",
scriptpath: getScriptPath(),
preventmultitouchscrolling: true,
disablemutationobserver: false,
enableobserver: true,
scrollbarid: false
};
var browserdetected = false;
var getBrowserDetection = function () {
if (browserdetected) return browserdetected;
var _el = _doc.createElement('DIV'),
_style = _el.style,
_agent = navigator.userAgent,
_platform = navigator.platform,
d = {};
d.haspointerlock = "pointerLockElement" in _doc || "webkitPointerLockElement" in _doc || "mozPointerLockElement" in _doc;
d.isopera = ("opera" in _win); // 12-
d.isopera12 = (d.isopera && ("getUserMedia" in navigator));
d.isoperamini = (Object.prototype.toString.call(_win.operamini) === "[object OperaMini]");
d.isie = (("all" in _doc) && ("attachEvent" in _el) && !d.isopera); //IE10-
d.isieold = (d.isie && !("msInterpolationMode" in _style)); // IE6 and older
d.isie7 = d.isie && !d.isieold && (!("documentMode" in _doc) || (_doc.documentMode === 7));
d.isie8 = d.isie && ("documentMode" in _doc) && (_doc.documentMode === 8);
d.isie9 = d.isie && ("performance" in _win) && (_doc.documentMode === 9);
d.isie10 = d.isie && ("performance" in _win) && (_doc.documentMode === 10);
d.isie11 = ("msRequestFullscreen" in _el) && (_doc.documentMode >= 11); // IE11+
d.ismsedge = ("msCredentials" in _win); // MS Edge 14+
d.ismozilla = ("MozAppearance" in _style);
d.iswebkit = !d.ismsedge && ("WebkitAppearance" in _style);
d.ischrome = d.iswebkit && ("chrome" in _win);
d.ischrome38 = (d.ischrome && ("touchAction" in _style)); // behavior changed in touch emulation
d.ischrome22 = (!d.ischrome38) && (d.ischrome && d.haspointerlock);
d.ischrome26 = (!d.ischrome38) && (d.ischrome && ("transition" in _style)); // issue with transform detection (maintain prefix)
d.cantouch = ("ontouchstart" in _doc.documentElement) || ("ontouchstart" in _win); // with detection for Chrome Touch Emulation
d.hasw3ctouch = (_win.PointerEvent || false) && ((navigator.maxTouchPoints > 0) || (navigator.msMaxTouchPoints > 0)); //IE11 pointer events, following W3C Pointer Events spec
d.hasmstouch = (!d.hasw3ctouch) && (_win.MSPointerEvent || false); // IE10 pointer events
d.ismac = /^mac$/i.test(_platform);
d.isios = d.cantouch && /iphone|ipad|ipod/i.test(_platform);
d.isios4 = d.isios && !("seal" in Object);
d.isios7 = d.isios && ("webkitHidden" in _doc); //iOS 7+
d.isios8 = d.isios && ("hidden" in _doc); //iOS 8+
d.isios10 = d.isios && _win.Proxy; //iOS 10+
d.isandroid = (/android/i.test(_agent));
d.haseventlistener = ("addEventListener" in _el);
d.trstyle = false;
d.hastransform = false;
d.hastranslate3d = false;
d.transitionstyle = false;
d.hastransition = false;
d.transitionend = false;
d.trstyle = "transform";
d.hastransform = ("transform" in _style) || (function () {
var check = ['msTransform', 'webkitTransform', 'MozTransform', 'OTransform'];
for (var a = 0, c = check.length; a < c; a++) {
if (_style[check[a]] !== undefined) {
d.trstyle = check[a];
break;
}
}
d.hastransform = (!!d.trstyle);
})();
if (d.hastransform) {
_style[d.trstyle] = "translate3d(1px,2px,3px)";
d.hastranslate3d = /translate3d/.test(_style[d.trstyle]);
}
d.transitionstyle = "transition";
d.prefixstyle = '';
d.transitionend = "transitionend";
d.hastransition = ("transition" in _style) || (function () {
d.transitionend = false;
var check = ['webkitTransition', 'msTransition', 'MozTransition', 'OTransition', 'OTransition', 'KhtmlTransition'];
var prefix = ['-webkit-', '-ms-', '-moz-', '-o-', '-o', '-khtml-'];
var evs = ['webkitTransitionEnd', 'msTransitionEnd', 'transitionend', 'otransitionend', 'oTransitionEnd', 'KhtmlTransitionEnd'];
for (var a = 0, c = check.length; a < c; a++) {
if (check[a] in _style) {
d.transitionstyle = check[a];
d.prefixstyle = prefix[a];
d.transitionend = evs[a];
break;
}
}
if (d.ischrome26) d.prefixstyle = prefix[1]; // always use prefix
d.hastransition = (d.transitionstyle);
})();
function detectCursorGrab() {
var lst = ['grab', '-webkit-grab', '-moz-grab'];
if ((d.ischrome && !d.ischrome38) || d.isie) lst = []; // force setting for IE returns false positive and chrome cursor bug
for (var a = 0, l = lst.length; a < l; a++) {
var p = lst[a];
_style.cursor = p;
if (_style.cursor == p) return p;
}
return 'url(https://cdnjs.cloudflare.com/ajax/libs/slider-pro/1.3.0/css/images/openhand.cur),n-resize'; // thanks to https://cdnjs.com/ for the openhand cursor!
}
d.cursorgrabvalue = detectCursorGrab();
d.hasmousecapture = ("setCapture" in _el);
d.hasMutationObserver = (ClsMutationObserver !== false);
_el = null; //memory released
browserdetected = d;
return d;
};
var NiceScrollClass = function (myopt, me) {
var self = this;
this.version = '3.7.6';
this.name = 'nicescroll';
this.me = me;
var $body = $("body");
var opt = this.opt = {
doc: $body,
win: false
};
$.extend(opt, _globaloptions); // clone opts
// Options for internal use
opt.snapbackspeed = 80;
if (myopt || false) {
for (var a in opt) {
if (myopt[a] !== undefined) opt[a] = myopt[a];
}
}
if (opt.disablemutationobserver) ClsMutationObserver = false;
this.doc = opt.doc;
this.iddoc = (this.doc && this.doc[0]) ? this.doc[0].id || '' : '';
this.ispage = /^BODY|HTML/.test((opt.win) ? opt.win[0].nodeName : this.doc[0].nodeName);
this.haswrapper = (opt.win !== false);
this.win = opt.win || (this.ispage ? $window : this.doc);
this.docscroll = (this.ispage && !this.haswrapper) ? $window : this.win;
this.body = $body;
this.viewport = false;
this.isfixed = false;
this.iframe = false;
this.isiframe = ((this.doc[0].nodeName == 'IFRAME') && (this.win[0].nodeName == 'IFRAME'));
this.istextarea = (this.win[0].nodeName == 'TEXTAREA');
this.forcescreen = false; //force to use screen position on events
this.canshowonmouseevent = (opt.autohidemode != "scroll");
// Events jump table
this.onmousedown = false;
this.onmouseup = false;
this.onmousemove = false;
this.onmousewheel = false;
this.onkeypress = false;
this.ongesturezoom = false;
this.onclick = false;
// Nicescroll custom events
this.onscrollstart = false;
this.onscrollend = false;
this.onscrollcancel = false;
this.onzoomin = false;
this.onzoomout = false;
// Let's start!
this.view = false;
this.page = false;
this.scroll = {
x: 0,
y: 0
};
this.scrollratio = {
x: 0,
y: 0
};
this.cursorheight = 20;
this.scrollvaluemax = 0;
// http://dev.w3.org/csswg/css-writing-modes-3/#logical-to-physical
// http://dev.w3.org/csswg/css-writing-modes-3/#svg-writing-mode
if (opt.rtlmode == "auto") {
var target = this.win[0] == _win ? this.body : this.win;
var writingMode = target.css("writing-mode") || target.css("-webkit-writing-mode") || target.css("-ms-writing-mode") || target.css("-moz-writing-mode");
if (writingMode == "horizontal-tb" || writingMode == "lr-tb" || writingMode === "") {
this.isrtlmode = (target.css("direction") == "rtl");
this.isvertical = false;
} else {
this.isrtlmode = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl" || writingMode == "rl-tb");
this.isvertical = (writingMode == "vertical-rl" || writingMode == "tb" || writingMode == "tb-rl");
}
} else {
this.isrtlmode = (opt.rtlmode === true);
this.isvertical = false;
}
// this.checkrtlmode = false;
this.scrollrunning = false;
this.scrollmom = false;
this.observer = false; // observer div changes
this.observerremover = false; // observer on parent for remove detection
this.observerbody = false; // observer on body for position change
if (opt.scrollbarid !== false) {
this.id = opt.scrollbarid;
} else {
do {
this.id = "ascrail" + (ascrailcounter++);
} while (_doc.getElementById(this.id));
}
this.rail = false;
this.cursor = false;
this.cursorfreezed = false;
this.selectiondrag = false;
this.zoom = false;
this.zoomactive = false;
this.hasfocus = false;
this.hasmousefocus = false;
//this.visibility = true;
this.railslocked = false; // locked by resize
this.locked = false; // prevent lost of locked status sets by user
this.hidden = false; // rails always hidden
this.cursoractive = true; // user can interact with cursors
this.wheelprevented = false; //prevent mousewheel event
this.overflowx = opt.overflowx;
this.overflowy = opt.overflowy;
this.nativescrollingarea = false;
this.checkarea = 0;
this.events = []; // event list for unbind
this.saved = {}; // style saved
this.delaylist = {};
this.synclist = {};
this.lastdeltax = 0;
this.lastdeltay = 0;
this.detected = getBrowserDetection();
var cap = $.extend({}, this.detected);
this.canhwscroll = (cap.hastransform && opt.hwacceleration);
this.ishwscroll = (this.canhwscroll && self.haswrapper);
if (!this.isrtlmode) {
this.hasreversehr = false;
} else if (this.isvertical) { // RTL mode with reverse horizontal axis
this.hasreversehr = !(cap.iswebkit || cap.isie || cap.isie11);
} else {
this.hasreversehr = !(cap.iswebkit || (cap.isie && !cap.isie10 && !cap.isie11));
}
this.istouchcapable = false; // desktop devices with touch screen support
//## Check WebKit-based desktop with touch support
//## + Firefox 18 nightly build (desktop) false positive (or desktop with touch support)
if (!cap.cantouch && (cap.hasw3ctouch || cap.hasmstouch)) { // desktop device with multiple input
this.istouchcapable = true;
} else if (cap.cantouch && !cap.isios && !cap.isandroid && (cap.iswebkit || cap.ismozilla)) {
this.istouchcapable = true;
}
//## disable MouseLock API on user request
if (!opt.enablemouselockapi) {
cap.hasmousecapture = false;
cap.haspointerlock = false;
}
this.debounced = function (name, fn, tm) {
if (!self) return;
var dd = self.delaylist[name] || false;
if (!dd) {
self.delaylist[name] = {
h: setAnimationFrame(function () {
self.delaylist[name].fn.call(self);
self.delaylist[name] = false;
}, tm)
};
fn.call(self);
}
self.delaylist[name].fn = fn;
};
this.synched = function (name, fn) {
if (self.synclist[name]) self.synclist[name] = fn;
else {
self.synclist[name] = fn;
setAnimationFrame(function () {
if (!self) return;
self.synclist[name] && self.synclist[name].call(self);
self.synclist[name] = null;
});
}
};
this.unsynched = function (name) {
if (self.synclist[name]) self.synclist[name] = false;
};
this.css = function (el, pars) { // save & set
for (var n in pars) {
self.saved.css.push([el, n, el.css(n)]);
el.css(n, pars[n]);
}
};
this.scrollTop = function (val) {
return (val === undefined) ? self.getScrollTop() : self.setScrollTop(val);
};
this.scrollLeft = function (val) {
return (val === undefined) ? self.getScrollLeft() : self.setScrollLeft(val);
};
// derived by by Dan Pupius www.pupius.net
var BezierClass = function (st, ed, spd, p1, p2, p3, p4) {
this.st = st;
this.ed = ed;
this.spd = spd;
this.p1 = p1 || 0;
this.p2 = p2 || 1;
this.p3 = p3 || 0;
this.p4 = p4 || 1;
this.ts = now();
this.df = ed - st;
};
BezierClass.prototype = {
B2: function (t) {
return 3 * (1 - t) * (1 - t) * t;
},
B3: function (t) {
return 3 * (1 - t) * t * t;
},
B4: function (t) {
return t * t * t;
},
getPos: function () {
return (now() - this.ts) / this.spd;
},
getNow: function () {
var pc = (now() - this.ts) / this.spd;
var bz = this.B2(pc) + this.B3(pc) + this.B4(pc);
return (pc >= 1) ? this.ed : this.st + (this.df * bz) | 0;
},
update: function (ed, spd) {
this.st = this.getNow();
this.ed = ed;
this.spd = spd;
this.ts = now();
this.df = this.ed - this.st;
return this;
}
};
//derived from http://stackoverflow.com/questions/11236090/
function getMatrixValues() {
var tr = self.doc.css(cap.trstyle);
if (tr && (tr.substr(0, 6) == "matrix")) {
return tr.replace(/^.*\((.*)\)$/g, "$1").replace(/px/g, '').split(/, +/);
}
return false;
}
if (this.ishwscroll) { // hw accelerated scroll
this.doc.translate = {
x: 0,
y: 0,
tx: "0px",
ty: "0px"
};
//this one can help to enable hw accel on ios6 http://indiegamr.com/ios6-html-hardware-acceleration-changes-and-how-to-fix-them/
if (cap.hastranslate3d && cap.isios) this.doc.css("-webkit-backface-visibility", "hidden"); // prevent flickering http://stackoverflow.com/questions/3461441/
this.getScrollTop = function (last) {
if (!last) {
var mtx = getMatrixValues();
if (mtx) return (mtx.length == 16) ? -mtx[13] : -mtx[5]; //matrix3d 16 on IE10
if (self.timerscroll && self.timerscroll.bz) return self.timerscroll.bz.getNow();
}
return self.doc.translate.y;
};
this.getScrollLeft = function (last) {
if (!last) {
var mtx = getMatrixValues();
if (mtx) return (mtx.length == 16) ? -mtx[12] : -mtx[4]; //matrix3d 16 on IE10
if (self.timerscroll && self.timerscroll.bh) return self.timerscroll.bh.getNow();
}
return self.doc.translate.x;
};
this.notifyScrollEvent = function (el) {
var e = _doc.createEvent("UIEvents");
e.initUIEvent("scroll", false, false, _win, 1);
e.niceevent = true;
el.dispatchEvent(e);
};
var cxscrollleft = (this.isrtlmode) ? 1 : -1;
if (cap.hastranslate3d && opt.enabletranslate3d) {
this.setScrollTop = function (val, silent) {
self.doc.translate.y = val;
self.doc.translate.ty = (val * -1) + "px";
self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0)");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
this.setScrollLeft = function (val, silent) {
self.doc.translate.x = val;
self.doc.translate.tx = (val * cxscrollleft) + "px";
self.doc.css(cap.trstyle, "translate3d(" + self.doc.translate.tx + "," + self.doc.translate.ty + ",0)");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
} else {
this.setScrollTop = function (val, silent) {
self.doc.translate.y = val;
self.doc.translate.ty = (val * -1) + "px";
self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
this.setScrollLeft = function (val, silent) {
self.doc.translate.x = val;
self.doc.translate.tx = (val * cxscrollleft) + "px";
self.doc.css(cap.trstyle, "translate(" + self.doc.translate.tx + "," + self.doc.translate.ty + ")");
if (!silent) self.notifyScrollEvent(self.win[0]);
};
}
} else { // native scroll
this.getScrollTop = function () {
return self.docscroll.scrollTop();
};
this.setScrollTop = function (val) {
self.docscroll.scrollTop(val);
};
this.getScrollLeft = function () {
var val;
if (!self.hasreversehr) {
val = self.docscroll.scrollLeft();
} else if (self.detected.ismozilla) {
val = self.page.maxw - Math.abs(self.docscroll.scrollLeft());
} else {
val = self.page.maxw - self.docscroll.scrollLeft();
}
return val;
};
this.setScrollLeft = function (val) {
return setTimeout(function () {
if (!self) return;
if (self.hasreversehr) {
if (self.detected.ismozilla) {
val = -(self.page.maxw - val);
} else {
val = self.page.maxw - val;
}
}
return self.docscroll.scrollLeft(val);
}, 1);
};
}
this.getTarget = function (e) {
if (!e) return false;
if (e.target) return e.target;
if (e.srcElement) return e.srcElement;
return false;
};
this.hasParent = function (e, id) {
if (!e) return false;
var el = e.target || e.srcElement || e || false;
while (el && el.id != id) {
el = el.parentNode || false;
}
return (el !== false);
};
function getZIndex() {
var dom = self.win;
if ("zIndex" in dom) return dom.zIndex(); // use jQuery UI method when available
while (dom.length > 0) {
if (dom[0].nodeType == 9) return false;
var zi = dom.css('zIndex');
if (!isNaN(zi) && zi !== 0) return parseInt(zi);
dom = dom.parent();
}
return false;
}
//inspired by http://forum.jquery.com/topic/width-includes-border-width-when-set-to-thin-medium-thick-in-ie
var _convertBorderWidth = {
"thin": 1,
"medium": 3,
"thick": 5
};
function getWidthToPixel(dom, prop, chkheight) {
var wd = dom.css(prop);
var px = parseFloat(wd);
if (isNaN(px)) {
px = _convertBorderWidth[wd] || 0;
var brd = (px == 3) ? ((chkheight) ? (self.win.outerHeight() - self.win.innerHeight()) : (self.win.outerWidth() - self.win.innerWidth())) : 1; //DON'T TRUST CSS
if (self.isie8 && px) px += 1;
return (brd) ? px : 0;
}
return px;
}
this.getDocumentScrollOffset = function () {
return {
top: _win.pageYOffset || _doc.documentElement.scrollTop,
left: _win.pageXOffset || _doc.documentElement.scrollLeft
};
};
this.getOffset = function () {
if (self.isfixed) {
var ofs = self.win.offset(); // fix Chrome auto issue (when right/bottom props only)
var scrl = self.getDocumentScrollOffset();
ofs.top -= scrl.top;
ofs.left -= scrl.left;
return ofs;
}
var ww = self.win.offset();
if (!self.viewport) return ww;
var vp = self.viewport.offset();
return {
top: ww.top - vp.top,
left: ww.left - vp.left
};
};
this.updateScrollBar = function (len) {
var pos, off;
if (self.ishwscroll) {
self.rail.css({
height: self.win.innerHeight() - (opt.railpadding.top + opt.railpadding.bottom)
});
if (self.railh) self.railh.css({
width: self.win.innerWidth() - (opt.railpadding.left + opt.railpadding.right)
});
} else {
var wpos = self.getOffset();
pos = {
top: wpos.top,
left: wpos.left - (opt.railpadding.left + opt.railpadding.right)
};
pos.top += getWidthToPixel(self.win, 'border-top-width', true);
pos.left += (self.rail.align) ? self.win.outerWidth() - getWidthToPixel(self.win, 'border-right-width') - self.rail.width : getWidthToPixel(self.win, 'border-left-width');
off = opt.railoffset;
if (off) {
if (off.top) pos.top += off.top;
if (off.left) pos.left += off.left;
}
if (!self.railslocked) self.rail.css({
top: pos.top,
left: pos.left,
height: ((len) ? len.h : self.win.innerHeight()) - (opt.railpadding.top + opt.railpadding.bottom)
});
if (self.zoom) {
self.zoom.css({
top: pos.top + 1,
left: (self.rail.align == 1) ? pos.left - 20 : pos.left + self.rail.width + 4
});
}
if (self.railh && !self.railslocked) {
pos = {
top: wpos.top,
left: wpos.left
};
off = opt.railhoffset;
if (off) {
if (off.top) pos.top += off.top;
if (off.left) pos.left += off.left;
}
var y = (self.railh.align) ? pos.top + getWidthToPixel(self.win, 'border-top-width', true) + self.win.innerHeight() - self.railh.height : pos.top + getWidthToPixel(self.win, 'border-top-width', true);
var x = pos.left + getWidthToPixel(self.win, 'border-left-width');
self.railh.css({
top: y - (opt.railpadding.top + opt.railpadding.bottom),
left: x,
width: self.railh.width
});
}
}
};
this.doRailClick = function (e, dbl, hr) {
var fn, pg, cur, pos;
if (self.railslocked) return;
self.cancelEvent(e);
if (!("pageY" in e)) {
e.pageX = e.clientX + _doc.documentElement.scrollLeft;
e.pageY = e.clientY + _doc.documentElement.scrollTop;
}
if (dbl) {
fn = (hr) ? self.doScrollLeft : self.doScrollTop;
cur = (hr) ? ((e.pageX - self.railh.offset().left - (self.cursorwidth / 2)) * self.scrollratio.x) : ((e.pageY - self.rail.offset().top - (self.cursorheight / 2)) * self.scrollratio.y);
self.unsynched("relativexy");
fn(cur|0);
} else {
fn = (hr) ? self.doScrollLeftBy : self.doScrollBy;
cur = (hr) ? self.scroll.x : self.scroll.y;
pos = (hr) ? e.pageX - self.railh.offset().left : e.pageY - self.rail.offset().top;
pg = (hr) ? self.view.w : self.view.h;
fn((cur >= pos) ? pg : -pg);
}
};
self.newscrolly = self.newscrollx = 0;
self.hasanimationframe = ("requestAnimationFrame" in _win);
self.hascancelanimationframe = ("cancelAnimationFrame" in _win);
self.hasborderbox = false;
this.init = function () {
self.saved.css = [];
if (cap.isoperamini) return true; // SORRY, DO NOT WORK!
if (cap.isandroid && !("hidden" in _doc)) return true; // Android 3- SORRY, DO NOT WORK!
opt.emulatetouch = opt.emulatetouch || opt.touchbehavior; // mantain compatibility with "touchbehavior"
self.hasborderbox = _win.getComputedStyle && (_win.getComputedStyle(_doc.body)['box-sizing'] === "border-box");
var _scrollyhidden = { 'overflow-y': 'hidden' };
if (cap.isie11 || cap.isie10) _scrollyhidden['-ms-overflow-style'] = 'none'; // IE 10 & 11 is always a world apart!
if (self.ishwscroll) {
this.doc.css(cap.transitionstyle, cap.prefixstyle + 'transform 0ms ease-out');
if (cap.transitionend) self.bind(self.doc, cap.transitionend, self.onScrollTransitionEnd, false); //I have got to do something usefull!!
}
self.zindex = "auto";
if (!self.ispage && opt.zindex == "auto") {
self.zindex = getZIndex() || "auto";
} else {
self.zindex = opt.zindex;
}
if (!self.ispage && self.zindex != "auto" && self.zindex > globalmaxzindex) {
globalmaxzindex = self.zindex;
}
if (self.isie && self.zindex === 0 && opt.zindex == "auto") { // fix IE auto == 0
self.zindex = "auto";
}
if (!self.ispage || !cap.isieold) {
var cont = self.docscroll;
if (self.ispage) cont = (self.haswrapper) ? self.win : self.doc;
self.css(cont, _scrollyhidden);
if (self.ispage && (cap.isie11 || cap.isie)) { // IE 7-11
self.css($("html"), _scrollyhidden);
}
if (cap.isios && !self.ispage && !self.haswrapper) self.css($body, {
"-webkit-overflow-scrolling": "touch"
}); //force hw acceleration
var cursor = $(_doc.createElement('div'));
cursor.css({
position: "relative",
top: 0,
"float": "right",
width: opt.cursorwidth,
height: 0,
'background-color': opt.cursorcolor,
border: opt.cursorborder,
'background-clip': 'padding-box',
'-webkit-border-radius': opt.cursorborderradius,
'-moz-border-radius': opt.cursorborderradius,
'border-radius': opt.cursorborderradius
});
cursor.addClass('nicescroll-cursors');
self.cursor = cursor;
var rail = $(_doc.createElement('div'));
rail.attr('id', self.id);
rail.addClass('nicescroll-rails nicescroll-rails-vr');
var v, a, kp = ["left", "right", "top", "bottom"]; //**
for (var n in kp) {
a = kp[n];
v = opt.railpadding[a] || 0;
v && rail.css("padding-" + a, v + "px");
}
rail.append(cursor);
rail.width = Math.max(parseFloat(opt.cursorwidth), cursor.outerWidth());
rail.css({
width: rail.width + "px",
zIndex: self.zindex,
background: opt.background,
cursor: "default"
});
rail.visibility = true;
rail.scrollable = true;
rail.align = (opt.railalign == "left") ? 0 : 1;
self.rail = rail;
self.rail.drag = false;
var zoom = false;
if (opt.boxzoom && !self.ispage && !cap.isieold) {
zoom = _doc.createElement('div');
self.bind(zoom, "click", self.doZoom);
self.bind(zoom, "mouseenter", function () {
self.zoom.css('opacity', opt.cursoropacitymax);
});
self.bind(zoom, "mouseleave", function () {
self.zoom.css('opacity', opt.cursoropacitymin);
});
self.zoom = $(zoom);
self.zoom.css({
cursor: "pointer",
zIndex: self.zindex,
backgroundImage: 'url(' + opt.scriptpath + 'zoomico.png)',
height: 18,
width: 18,
backgroundPosition: '0 0'
});
if (opt.dblclickzoom) self.bind(self.win, "dblclick", self.doZoom);
if (cap.cantouch && opt.gesturezoom) {
self.ongesturezoom = function (e) {
if (e.scale > 1.5) self.doZoomIn(e);
if (e.scale < 0.8) self.doZoomOut(e);
return self.cancelEvent(e);
};
self.bind(self.win, "gestureend", self.ongesturezoom);
}
}
// init HORIZ
self.railh = false;
var railh;
if (opt.horizrailenabled) {
self.css(cont, {
overflowX: 'hidden'
});
cursor = $(_doc.createElement('div'));
cursor.css({
position: "absolute",
top: 0,
height: opt.cursorwidth,
width: 0,
backgroundColor: opt.cursorcolor,
border: opt.cursorborder,
backgroundClip: 'padding-box',
'-webkit-border-radius': opt.cursorborderradius,
'-moz-border-radius': opt.cursorborderradius,
'border-radius': opt.cursorborderradius
});
if (cap.isieold) cursor.css('overflow', 'hidden'); //IE6 horiz scrollbar issue
cursor.addClass('nicescroll-cursors');
self.cursorh = cursor;
railh = $(_doc.createElement('div'));
railh.attr('id', self.id + '-hr');
railh.addClass('nicescroll-rails nicescroll-rails-hr');
railh.height = Math.max(parseFloat(opt.cursorwidth), cursor.outerHeight());
railh.css({
height: railh.height + "px",
'zIndex': self.zindex,
"background": opt.background
});
railh.append(cursor);
railh.visibility = true;
railh.scrollable = true;
railh.align = (opt.railvalign == "top") ? 0 : 1;
self.railh = railh;
self.railh.drag = false;
}
if (self.ispage) {
rail.css({
position: "fixed",
top: 0,
height: "100%"
});
rail.css((rail.align) ? { right: 0 } : { left: 0 });
self.body.append(rail);
if (self.railh) {
railh.css({
position: "fixed",
left: 0,
width: "100%"
});
railh.css((railh.align) ? { bottom: 0 } : { top: 0 });
self.body.append(railh);
}
} else {
if (self.ishwscroll) {
if (self.win.css('position') == 'static') self.css(self.win, { 'position': 'relative' });
var bd = (self.win[0].nodeName == 'HTML') ? self.body : self.win;
$(bd).scrollTop(0).scrollLeft(0); // fix rail position if content already scrolled
if (self.zoom) {
self.zoom.css({
position: "absolute",
top: 1,
right: 0,
"margin-right": rail.width + 4
});
bd.append(self.zoom);
}
rail.css({
position: "absolute",
top: 0
});
rail.css((rail.align) ? { right: 0 } : { left: 0 });
bd.append(rail);
if (railh) {
railh.css({
position: "absolute",
left: 0,
bottom: 0
});
railh.css((railh.align) ? { bottom: 0 } : { top: 0 });
bd.append(railh);
}
} else {
self.isfixed = (self.win.css("position") == "fixed");
var rlpos = (self.isfixed) ? "fixed" : "absolute";
if (!self.isfixed) self.viewport = self.getViewport(self.win[0]);
if (self.viewport) {
self.body = self.viewport;
if (!(/fixed|absolute/.test(self.viewport.css("position")))) self.css(self.viewport, {
"position": "relative"
});
}
rail.css({
position: rlpos
});
if (self.zoom) self.zoom.css({
position: rlpos
});
self.updateScrollBar();
self.body.append(rail);
if (self.zoom) self.body.append(self.zoom);
if (self.railh) {
railh.css({
position: rlpos
});
self.body.append(railh);
}
}
if (cap.isios) self.css(self.win, {
'-webkit-tap-highlight-color': 'rgba(0,0,0,0)',
'-webkit-touch-callout': 'none'
}); // prevent grey layer on click
if (opt.disableoutline) {
if (cap.isie) self.win.attr("hideFocus", "true"); // IE, prevent dotted rectangle on focused div
if (cap.iswebkit) self.win.css('outline', 'none'); // Webkit outline
}
}
if (opt.autohidemode === false) {
self.autohidedom = false;
self.rail.css({
opacity: opt.cursoropacitymax
});
if (self.railh) self.railh.css({
opacity: opt.cursoropacitymax
});
} else if ((opt.autohidemode === true) || (opt.autohidemode === "leave")) {
self.autohidedom = $().add(self.rail);
if (cap.isie8) self.autohidedom = self.autohidedom.add(self.cursor);
if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
if (self.railh && cap.isie8) self.autohidedom = self.autohidedom.add(self.cursorh);
} else if (opt.autohidemode == "scroll") {
self.autohidedom = $().add(self.rail);
if (self.railh) self.autohidedom = self.autohidedom.add(self.railh);
} else if (opt.autohidemode == "cursor") {
self.autohidedom = $().add(self.cursor);
if (self.railh) self.autohidedom = self.autohidedom.add(self.cursorh);
} else if (opt.autohidemode == "hidden") {
self.autohidedom = false;
self.hide();
self.railslocked = false;
}
if (cap.cantouch || self.istouchcapable || opt.emulatetouch || cap.hasmstouch) {
self.scrollmom = new ScrollMomentumClass2D(self);
var delayedclick = null;
self.ontouchstart = function (e) {
if (self.locked) return false;
//if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return false; // need test on surface!!
self.hasmoving = false;
if (self.scrollmom.timer) {
self.triggerScrollEnd();
self.scrollmom.stop();
}
if (!self.railslocked) {
var tg = self.getTarget(e);
if (tg) {
var skp = (/INPUT/i.test(tg.nodeName)) && (/range/i.test(tg.type));
if (skp) return self.stopPropagation(e);
}
var ismouse = (e.type === "mousedown");
if (!("clientX" in e) && ("changedTouches" in e)) {
e.clientX = e.changedTouches[0].clientX;
e.clientY = e.changedTouches[0].clientY;
}
if (self.forcescreen) {
var le = e;
e = {
"original": (e.original) ? e.original : e
};
e.clientX = le.screenX;
e.clientY = le.screenY;
}
self.rail.drag = {
x: e.clientX,
y: e.clientY,
sx: self.scroll.x,
sy: self.scroll.y,
st: self.getScrollTop(),
sl: self.getScrollLeft(),
pt: 2,
dl: false,
tg: tg
};
if (self.ispage || !opt.directionlockdeadzone) {
self.rail.drag.dl = "f";
} else {
var view = {
w: $window.width(),
h: $window.height()
};
var page = self.getContentSize();
var maxh = page.h - view.h;
var maxw = page.w - view.w;
if (self.rail.scrollable && !self.railh.scrollable) self.rail.drag.ck = (maxh > 0) ? "v" : false;
else if (!self.rail.scrollable && self.railh.scrollable) self.rail.drag.ck = (maxw > 0) ? "h" : false;
else self.rail.drag.ck = false;
}
if (opt.emulatetouch && self.isiframe && cap.isie) {
var wp = self.win.position();
self.rail.drag.x += wp.left;
self.rail.drag.y += wp.top;
}
self.hasmoving = false;
self.lastmouseup = false;
self.scrollmom.reset(e.clientX, e.clientY);
if (tg&&ismouse) {
var ip = /INPUT|SELECT|BUTTON|TEXTAREA/i.test(tg.nodeName);
if (!ip) {
if (cap.hasmousecapture) tg.setCapture();
if (opt.emulatetouch) {
if (tg.onclick && !(tg._onclick || false)) { // intercept DOM0 onclick event
tg._onclick = tg.onclick;
tg.onclick = function (e) {
if (self.hasmoving) return false;
tg._onclick.call(this, e);
};
}
return self.cancelEvent(e);
}
return self.stopPropagation(e);
}
if (/SUBMIT|CANCEL|BUTTON/i.test($(tg).attr('type'))) {
self.preventclick = {
"tg": tg,
"click": false
};
}
}
}
};
self.ontouchend = function (e) {
if (!self.rail.drag) return true;
if (self.rail.drag.pt == 2) {
//if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return false;
self.rail.drag = false;
var ismouse = (e.type === "mouseup");
if (self.hasmoving) {
self.scrollmom.doMomentum();
self.lastmouseup = true;
self.hideCursor();
if (cap.hasmousecapture) _doc.releaseCapture();
if (ismouse) return self.cancelEvent(e);
}
}
else if (self.rail.drag.pt == 1) {
return self.onmouseup(e);
}
};
var moveneedoffset = (opt.emulatetouch && self.isiframe && !cap.hasmousecapture);
var locktollerance = opt.directionlockdeadzone * 0.3 | 0;
self.ontouchmove = function (e, byiframe) {
if (!self.rail.drag) return true;
if (e.targetTouches && opt.preventmultitouchscrolling) {
if (e.targetTouches.length > 1) return true; // multitouch
}
//if (e.pointerType && e.pointerType != 2 && e.pointerType != "touch") return false;
if (e.pointerType && (e.pointerType === 'mouse' || e.pointerType === e.MSPOINTER_TYPE_MOUSE)) return true;
if (self.rail.drag.pt == 2) {
if (("changedTouches" in e)) {
e.clientX = e.changedTouches[0].clientX;
e.clientY = e.changedTouches[0].clientY;
}
var ofy, ofx;
ofx = ofy = 0;
if (moveneedoffset && !byiframe) {
var wp = self.win.position();
ofx = -wp.left;
ofy = -wp.top;
}
var fy = e.clientY + ofy;
var my = (fy - self.rail.drag.y);
var fx = e.clientX + ofx;
var mx = (fx - self.rail.drag.x);
var ny = self.rail.drag.st - my;
if (self.ishwscroll && opt.bouncescroll) {
if (ny < 0) {
ny = Math.round(ny / 2);
} else if (ny > self.page.maxh) {
ny = self.page.maxh + Math.round((ny - self.page.maxh) / 2);
}
} else {
if (ny < 0) {
ny = 0;
fy = 0;
}
else if (ny > self.page.maxh) {
ny = self.page.maxh;
fy = 0;
}
if (fy === 0 && !self.hasmoving) {
if (!self.ispage) self.rail.drag = false;
return true;
}
}
var nx = self.getScrollLeft();
if (self.railh && self.railh.scrollable) {
nx = (self.isrtlmode) ? mx - self.rail.drag.sl : self.rail.drag.sl - mx;
if (self.ishwscroll && opt.bouncescroll) {
if (nx < 0) {
nx = Math.round(nx / 2);
} else if (nx > self.page.maxw) {
nx = self.page.maxw + Math.round((nx - self.page.maxw) / 2);
}
} else {
if (nx < 0) {
nx = 0;
fx = 0;
}
if (nx > self.page.maxw) {
nx = self.page.maxw;
fx = 0;
}
}
}
if (!self.hasmoving) {
if (self.rail.drag.y === e.clientY && self.rail.drag.x === e.clientX) return self.cancelEvent(e); // prevent first useless move event
var ay = Math.abs(my);
var ax = Math.abs(mx);
var dz = opt.directionlockdeadzone;
if (!self.rail.drag.ck) {
if (ay > dz && ax > dz) self.rail.drag.dl = "f";
else if (ay > dz) self.rail.drag.dl = (ax > locktollerance) ? "f" : "v";
else if (ax > dz) self.rail.drag.dl = (ay > locktollerance) ? "f" : "h";
}
else if (self.rail.drag.ck == "v") {
if (ax > dz && ay <= locktollerance) {
self.rail.drag = false;
}
else if (ay > dz) self.rail.drag.dl = "v";
}
else if (self.rail.drag.ck == "h") {
if (ay > dz && ax <= locktollerance) {
self.rail.drag = false;
}
else if (ax > dz) self.rail.drag.dl = "h";
}
if (!self.rail.drag.dl) return self.cancelEvent(e);
self.triggerScrollStart(e.clientX, e.clientY, 0, 0, 0);
self.hasmoving = true;
}
if (self.preventclick && !self.preventclick.click) {
self.preventclick.click = self.preventclick.tg.onclick || false;
self.preventclick.tg.onclick = self.onpreventclick;
}
if (self.rail.drag.dl) {
if (self.rail.drag.dl == "v") nx = self.rail.drag.sl;
else if (self.rail.drag.dl == "h") ny = self.rail.drag.st;
}
self.synched("touchmove", function () {
if (self.rail.drag && (self.rail.drag.pt == 2)) {
if (self.prepareTransition) self.resetTransition();
if (self.rail.scrollable) self.setScrollTop(ny);
self.scrollmom.update(fx, fy);
if (self.railh && self.railh.scrollable) {
self.setScrollLeft(nx);
self.showCursor(ny, nx);
} else {
self.showCursor(ny);
}
if (cap.isie10) _doc.selection.clear();
}
});
return self.cancelEvent(e);
}
else if (self.rail.drag.pt == 1) { // drag on cursor
return self.onmousemove(e);
}
};
self.ontouchstartCursor = function (e, hronly) {
if (self.rail.drag && self.rail.drag.pt != 3) return;
if (self.locked) return self.cancelEvent(e);
self.cancelScroll();
self.rail.drag = {
x: e.touches[0].clientX,
y: e.touches[0].clientY,
sx: self.scroll.x,
sy: self.scroll.y,
pt: 3,
hr: (!!hronly)
};
var tg = self.getTarget(e);
if (!self.ispage && cap.hasmousecapture) tg.setCapture();
if (self.isiframe && !cap.hasmousecapture) {
self.saved.csspointerevents = self.doc.css("pointer-events");
self.css(self.doc, { "pointer-events": "none" });
}
return self.cancelEvent(e);
};
self.ontouchendCursor = function (e) {
if (self.rail.drag) {
if (cap.hasmousecapture) _doc.releaseCapture();
if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);
if (self.rail.drag.pt != 3) return;
self.rail.drag = false;
return self.cancelEvent(e);
}
};
self.ontouchmoveCursor = function (e) {
if (self.rail.drag) {
if (self.rail.drag.pt != 3) return;
self.cursorfreezed = true;
if (self.rail.drag.hr) {
self.scroll.x = self.rail.drag.sx + (e.touches[0].clientX - self.rail.drag.x);
if (self.scroll.x < 0) self.scroll.x = 0;
var mw = self.scrollvaluemaxw;
if (self.scroll.x > mw) self.scroll.x = mw;
} else {
self.scroll.y = self.rail.drag.sy + (e.touches[0].clientY - self.rail.drag.y);
if (self.scroll.y < 0) self.scroll.y = 0;
var my = self.scrollvaluemax;
if (self.scroll.y > my) self.scroll.y = my;
}
self.synched('touchmove', function () {
if (self.rail.drag && (self.rail.drag.pt == 3)) {
self.showCursor();
if (self.rail.drag.hr) self.doScrollLeft(Math.round(self.scroll.x * self.scrollratio.x), opt.cursordragspeed);
else self.doScrollTop(Math.round(self.scroll.y * self.scrollratio.y), opt.cursordragspeed);
}
});
return self.cancelEvent(e);
}
};
}
self.onmousedown = function (e, hronly) {
if (self.rail.drag && self.rail.drag.pt != 1) return;
if (self.railslocked) return self.cancelEvent(e);
self.cancelScroll();
self.rail.drag = {
x: e.clientX,
y: e.clientY,
sx: self.scroll.x,
sy: self.scroll.y,
pt: 1,
hr: hronly || false
};
var tg = self.getTarget(e);
if (cap.hasmousecapture) tg.setCapture();
if (self.isiframe && !cap.hasmousecapture) {
self.saved.csspointerevents = self.doc.css("pointer-events");
self.css(self.doc, {
"pointer-events": "none"
});
}
self.hasmoving = false;
return self.cancelEvent(e);
};
self.onmouseup = function (e) {
if (self.rail.drag) {
if (self.rail.drag.pt != 1) return true;
if (cap.hasmousecapture) _doc.releaseCapture();
if (self.isiframe && !cap.hasmousecapture) self.doc.css("pointer-events", self.saved.csspointerevents);
self.rail.drag = false;
self.cursorfreezed = false;
if (self.hasmoving) self.triggerScrollEnd();
return self.cancelEvent(e);
}
};
self.onmousemove = function (e) {
if (self.rail.drag) {
if (self.rail.drag.pt !== 1) return;
if (cap.ischrome && e.which === 0) return self.onmouseup(e);
self.cursorfreezed = true;
if (!self.hasmoving) self.triggerScrollStart(e.clientX, e.clientY, 0, 0, 0);
self.hasmoving = true;
if (self.rail.drag.hr) {
self.scroll.x = self.rail.drag.sx + (e.clientX - self.rail.drag.x);
if (self.scroll.x < 0) self.scroll.x = 0;
var mw = self.scrollvaluemaxw;
if (self.scroll.x > mw) self.scroll.x = mw;
} else {
self.scroll.y = self.rail.drag.sy + (e.clientY - self.rail.drag.y);
if (self.scroll.y < 0) self.scroll.y = 0;
var my = self.scrollvaluemax;
if (self.scroll.y > my) self.scroll.y = my;
}
self.synched('mousemove', function () {
if (self.cursorfreezed) {
self.showCursor();
if (self.rail.drag.hr) {
self.scrollLeft(Math.round(self.scroll.x * self.scrollratio.x));
} else {
self.scrollTop(Math.round(self.scroll.y * self.scrollratio.y));
}
}
});
return self.cancelEvent(e);
}
else {
self.checkarea = 0;
}
};
if (cap.cantouch || opt.emulatetouch) {
self.onpreventclick = function (e) {
if (self.preventclick) {
self.preventclick.tg.onclick = self.preventclick.click;
self.preventclick = false;
return self.cancelEvent(e);
}
};
self.onclick = (cap.isios) ? false : function (e) { // it needs to check IE11 ???
if (self.lastmouseup) {
self.lastmouseup = false;
return self.cancelEvent(e);
} else {
return true;
}
};
if (opt.grabcursorenabled && cap.cursorgrabvalue) {
self.css((self.ispage) ? self.doc : self.win, {
'cursor': cap.cursorgrabvalue
});
self.css(self.rail, {
'cursor': cap.cursorgrabvalue
});
}
} else {
var checkSelectionScroll = function (e) {
if (!self.selectiondrag) return;
if (e) {
var ww = self.win.outerHeight();
var df = (e.pageY - self.selectiondrag.top);
if (df > 0 && df < ww) df = 0;
if (df >= ww) df -= ww;
self.selectiondrag.df = df;
}
if (self.selectiondrag.df === 0) return;
var rt = -(self.selectiondrag.df*2/6)|0;
self.doScrollBy(rt);
self.debounced("doselectionscroll", function () {
checkSelectionScroll();
}, 50);
};
if ("getSelection" in _doc) { // A grade - Major browsers
self.hasTextSelected = function () {
return (_doc.getSelection().rangeCount > 0);
};
} else if ("selection" in _doc) { //IE9-
self.hasTextSelected = function () {
return (_doc.selection.type != "None");
};
} else {
self.hasTextSelected = function () { // no support
return false;
};
}
self.onselectionstart = function (e) {
// More testing - severe chrome issues
/*
if (!self.haswrapper&&(e.which&&e.which==2)) { // fool browser to manage middle button scrolling
self.win.css({'overflow':'auto'});
setTimeout(function(){
self.win.css({'overflow':'hidden'});
},10);
return true;
}
*/
if (self.ispage) return;
self.selectiondrag = self.win.offset();
};
self.onselectionend = function (e) {
self.selectiondrag = false;
};
self.onselectiondrag = function (e) {
if (!self.selectiondrag) return;
if (self.hasTextSelected()) self.debounced("selectionscroll", function () {
checkSelectionScroll(e);
}, 250);
};
}
if (cap.hasw3ctouch) { //IE11+
self.css((self.ispage) ? $("html") : self.win, { 'touch-action': 'none' });
self.css(self.rail, {
'touch-action': 'none'
});
self.css(self.cursor, {
'touch-action': 'none'
});
self.bind(self.win, "pointerdown", self.ontouchstart);
self.bind(_doc, "pointerup", self.ontouchend);
self.delegate(_doc, "pointermove", self.ontouchmove);
} else if (cap.hasmstouch) { //IE10
self.css((self.ispage) ? $("html") : self.win, { '-ms-touch-action': 'none' });
self.css(self.rail, {
'-ms-touch-action': 'none'
});
self.css(self.cursor, {
'-ms-touch-action': 'none'
});
self.bind(self.win, "MSPointerDown", self.ontouchstart);
self.bind(_doc, "MSPointerUp", self.ontouchend);
self.delegate(_doc, "MSPointerMove", self.ontouchmove);
self.bind(self.cursor, "MSGestureHold", function (e) {
e.preventDefault();
});
self.bind(self.cursor, "contextmenu", function (e) {
e.preventDefault();
});
} else if (cap.cantouch) { // smartphones/touch devices
self.bind(self.win, "touchstart", self.ontouchstart, false, true);
self.bind(_doc, "touchend", self.ontouchend, false, true);
self.bind(_doc, "touchcancel", self.ontouchend, false, true);
self.delegate(_doc, "touchmove", self.ontouchmove, false, true);
}
if (opt.emulatetouch) {
self.bind(self.win, "mousedown", self.ontouchstart, false, true);
self.bind(_doc, "mouseup", self.ontouchend, false, true);
self.bind(_doc, "mousemove", self.ontouchmove, false, true);
}
if (opt.cursordragontouch || (!cap.cantouch && !opt.emulatetouch)) {
self.rail.css({
cursor: "default"
});
self.railh && self.railh.css({
cursor: "default"
});
self.jqbind(self.rail, "mouseenter", function () {
if (!self.ispage && !self.win.is(":visible")) return false;
if (self.canshowonmouseevent) self.showCursor();
self.rail.active = true;
});
self.jqbind(self.rail, "mouseleave", function () {
self.rail.active = false;
if (!self.rail.drag) self.hideCursor();
});
if (opt.sensitiverail) {
self.bind(self.rail, "click", function (e) {
self.doRailClick(e, false, false);
});
self.bind(self.rail, "dblclick", function (e) {
self.doRailClick(e, true, false);
});
self.bind(self.cursor, "click", function (e) {
self.cancelEvent(e);
});
self.bind(self.cursor, "dblclick", function (e) {
self.cancelEvent(e);
});
}
if (self.railh) {
self.jqbind(self.railh, "mouseenter", function () {
if (!self.ispage && !self.win.is(":visible")) return false;
if (self.canshowonmouseevent) self.showCursor();
self.rail.active = true;
});
self.jqbind(self.railh, "mouseleave", function () {
self.rail.active = false;
if (!self.rail.drag) self.hideCursor();
});
if (opt.sensitiverail) {
self.bind(self.railh, "click", function (e) {
self.doRailClick(e, false, true);
});
self.bind(self.railh, "dblclick", function (e) {
self.doRailClick(e, true, true);
});
self.bind(self.cursorh, "click", function (e) {
self.cancelEvent(e);
});
self.bind(self.cursorh, "dblclick", function (e) {
self.cancelEvent(e);
});
}
}
}
if (opt.cursordragontouch && (this.istouchcapable || cap.cantouch)) {
self.bind(self.cursor, "touchstart", self.ontouchstartCursor);
self.bind(self.cursor, "touchmove", self.ontouchmoveCursor);
self.bind(self.cursor, "touchend", self.ontouchendCursor);
self.cursorh && self.bind(self.cursorh, "touchstart", function (e) {
self.ontouchstartCursor(e, true);
});
self.cursorh && self.bind(self.cursorh, "touchmove", self.ontouchmoveCursor);
self.cursorh && self.bind(self.cursorh, "touchend", self.ontouchendCursor);
}
// if (!cap.cantouch && !opt.emulatetouch) {
if (!opt.emulatetouch && !cap.isandroid && !cap.isios) {
self.bind((cap.hasmousecapture) ? self.win : _doc, "mouseup", self.onmouseup);
self.bind(_doc, "mousemove", self.onmousemove);
if (self.onclick) self.bind(_doc, "click", self.onclick);
self.bind(self.cursor, "mousedown", self.onmousedown);
self.bind(self.cursor, "mouseup", self.onmouseup);
if (self.railh) {
self.bind(self.cursorh, "mousedown", function (e) {
self.onmousedown(e, true);
});
self.bind(self.cursorh, "mouseup", self.onmouseup);
}
if (!self.ispage && opt.enablescrollonselection) {
self.bind(self.win[0], "mousedown", self.onselectionstart);
self.bind(_doc, "mouseup", self.onselectionend);
self.bind(self.cursor, "mouseup", self.onselectionend);
if (self.cursorh) self.bind(self.cursorh, "mouseup", self.onselectionend);
self.bind(_doc, "mousemove", self.onselectiondrag);
}
if (self.zoom) {
self.jqbind(self.zoom, "mouseenter", function () {
if (self.canshowonmouseevent) self.showCursor();
self.rail.active = true;
});
self.jqbind(self.zoom, "mouseleave", function () {
self.rail.active = false;
if (!self.rail.drag) self.hideCursor();
});
}
} else {
self.bind((cap.hasmousecapture) ? self.win : _doc, "mouseup", self.ontouchend);
if (self.onclick) self.bind(_doc, "click", self.onclick);
if (opt.cursordragontouch) {
self.bind(self.cursor, "mousedown", self.onmousedown);
self.bind(self.cursor, "mouseup", self.onmouseup);
self.cursorh && self.bind(self.cursorh, "mousedown", function (e) {
self.onmousedown(e, true);
});
self.cursorh && self.bind(self.cursorh, "mouseup", self.onmouseup);
} else {
self.bind(self.rail, "mousedown", function (e) { e.preventDefault(); }); // prevent text selection
self.railh && self.bind(self.railh, "mousedown", function (e) { e.preventDefault(); });
}
}
if (opt.enablemousewheel) {
if (!self.isiframe) self.mousewheel((cap.isie && self.ispage) ? _doc : self.win, self.onmousewheel);
self.mousewheel(self.rail, self.onmousewheel);
if (self.railh) self.mousewheel(self.railh, self.onmousewheelhr);
}
if (!self.ispage && !cap.cantouch && !(/HTML|^BODY/.test(self.win[0].nodeName))) {
if (!self.win.attr("tabindex")) self.win.attr({
"tabindex": ++tabindexcounter
});
self.bind(self.win, "focus", function (e) { // better using native events
domfocus = (self.getTarget(e)).id || self.getTarget(e) || false;
self.hasfocus = true;
if (self.canshowonmouseevent) self.noticeCursor();
});
self.bind(self.win, "blur", function (e) { // *
domfocus = false;
self.hasfocus = false;
});
self.bind(self.win, "mouseenter", function (e) { // *
mousefocus = (self.getTarget(e)).id || self.getTarget(e) || false;
self.hasmousefocus = true;
if (self.canshowonmouseevent) self.noticeCursor();
});
self.bind(self.win, "mouseleave", function (e) { // *
mousefocus = false;
self.hasmousefocus = false;
if (!self.rail.drag) self.hideCursor();
});
}
//Thanks to http://www.quirksmode.org !!
self.onkeypress = function (e) {
if (self.railslocked && self.page.maxh === 0) return true;
e = e || _win.event;
var tg = self.getTarget(e);
if (tg && /INPUT|TEXTAREA|SELECT|OPTION/.test(tg.nodeName)) {
var tp = tg.getAttribute('type') || tg.type || false;
if ((!tp) || !(/submit|button|cancel/i.tp)) return true;
}
if ($(tg).attr('contenteditable')) return true;
if (self.hasfocus || (self.hasmousefocus && !domfocus) || (self.ispage && !domfocus && !mousefocus)) {
var key = e.keyCode;
if (self.railslocked && key != 27) return self.cancelEvent(e);
var ctrl = e.ctrlKey || false;
var shift = e.shiftKey || false;
var ret = false;
switch (key) {
case 38:
case 63233: //safari
self.doScrollBy(24 * 3);
ret = true;
break;
case 40:
case 63235: //safari
self.doScrollBy(-24 * 3);
ret = true;
break;
case 37:
case 63232: //safari
if (self.railh) {
(ctrl) ? self.doScrollLeft(0) : self.doScrollLeftBy(24 * 3);
ret = true;
}
break;
case 39:
case 63234: //safari
if (self.railh) {
(ctrl) ? self.doScrollLeft(self.page.maxw) : self.doScrollLeftBy(-24 * 3);
ret = true;
}
break;
case 33:
case 63276: // safari
self.doScrollBy(self.view.h);
ret = true;
break;
case 34:
case 63277: // safari
self.doScrollBy(-self.view.h);
ret = true;
break;
case 36:
case 63273: // safari
(self.railh && ctrl) ? self.doScrollPos(0, 0) : self.doScrollTo(0);
ret = true;
break;
case 35:
case 63275: // safari
(self.railh && ctrl) ? self.doScrollPos(self.page.maxw, self.page.maxh) : self.doScrollTo(self.page.maxh);
ret = true;
break;
case 32:
if (opt.spacebarenabled) {
(shift) ? self.doScrollBy(self.view.h) : self.doScrollBy(-self.view.h);
ret = true;
}
break;
case 27: // ESC
if (self.zoomactive) {
self.doZoom();
ret = true;
}
break;
}
if (ret) return self.cancelEvent(e);
}
};
if (opt.enablekeyboard) self.bind(_doc, (cap.isopera && !cap.isopera12) ? "keypress" : "keydown", self.onkeypress);
self.bind(_doc, "keydown", function (e) {
var ctrl = e.ctrlKey || false;
if (ctrl) self.wheelprevented = true;
});
self.bind(_doc, "keyup", function (e) {
var ctrl = e.ctrlKey || false;
if (!ctrl) self.wheelprevented = false;
});
self.bind(_win, "blur", function (e) {
self.wheelprevented = false;
});
self.bind(_win, 'resize', self.onscreenresize);
self.bind(_win, 'orientationchange', self.onscreenresize);
self.bind(_win, "load", self.lazyResize);
if (cap.ischrome && !self.ispage && !self.haswrapper) { //chrome void scrollbar bug - it persists in version 26
var tmp = self.win.attr("style");
var ww = parseFloat(self.win.css("width")) + 1;
self.win.css('width', ww);
self.synched("chromefix", function () {
self.win.attr("style", tmp);
});
}
// Trying a cross-browser implementation - good luck!
self.onAttributeChange = function (e) {
self.lazyResize(self.isieold ? 250 : 30);
};
if (opt.enableobserver) {
if ((!self.isie11) && (ClsMutationObserver !== false)) { // IE11 crashes #568
self.observerbody = new ClsMutationObserver(function (mutations) {
mutations.forEach(function (mut) {
if (mut.type == "attributes") {
return ($body.hasClass("modal-open") && $body.hasClass("modal-dialog") && !$.contains($('.modal-dialog')[0], self.doc[0])) ? self.hide() : self.show(); // Support for Bootstrap modal; Added check if the nice scroll element is inside a modal
}
});
if (self.me.clientWidth != self.page.width || self.me.clientHeight != self.page.height) return self.lazyResize(30);
});
self.observerbody.observe(_doc.body, {
childList: true,
subtree: true,
characterData: false,
attributes: true,
attributeFilter: ['class']
});
}
if (!self.ispage && !self.haswrapper) {
var _dom = self.win[0];
// redesigned MutationObserver for Chrome18+/Firefox14+/iOS6+ with support for: remove div, add/remove content
if (ClsMutationObserver !== false) {
self.observer = new ClsMutationObserver(function (mutations) {
mutations.forEach(self.onAttributeChange);
});
self.observer.observe(_dom, {
childList: true,
characterData: false,
attributes: true,
subtree: false
});
self.observerremover = new ClsMutationObserver(function (mutations) {
mutations.forEach(function (mo) {
if (mo.removedNodes.length > 0) {
for (var dd in mo.removedNodes) {
if (!!self && (mo.removedNodes[dd] === _dom)) return self.remove();
}
}
});
});
self.observerremover.observe(_dom.parentNode, {
childList: true,
characterData: false,
attributes: false,
subtree: false
});
} else {
self.bind(_dom, (cap.isie && !cap.isie9) ? "propertychange" : "DOMAttrModified", self.onAttributeChange);
if (cap.isie9) _dom.attachEvent("onpropertychange", self.onAttributeChange); //IE9 DOMAttrModified bug
self.bind(_dom, "DOMNodeRemoved", function (e) {
if (e.target === _dom) self.remove();
});
}
}
}
//
if (!self.ispage && opt.boxzoom) self.bind(_win, "resize", self.resizeZoom);
if (self.istextarea) {
self.bind(self.win, "keydown", self.lazyResize);
self.bind(self.win, "mouseup", self.lazyResize);
}
self.lazyResize(30);
}
if (this.doc[0].nodeName == 'IFRAME') {
var oniframeload = function () {
self.iframexd = false;
var doc;
try {
doc = 'contentDocument' in this ? this.contentDocument : this.contentWindow._doc;
var a = doc.domain;
} catch (e) {
self.iframexd = true;
doc = false;
}
if (self.iframexd) {
if ("console" in _win) console.log('NiceScroll error: policy restriced iframe');
return true; //cross-domain - I can't manage this
}
self.forcescreen = true;
if (self.isiframe) {
self.iframe = {
"doc": $(doc),
"html": self.doc.contents().find('html')[0],
"body": self.doc.contents().find('body')[0]
};
self.getContentSize = function () {
return {
w: Math.max(self.iframe.html.scrollWidth, self.iframe.body.scrollWidth),
h: Math.max(self.iframe.html.scrollHeight, self.iframe.body.scrollHeight)
};
};
self.docscroll = $(self.iframe.body);
}
if (!cap.isios && opt.iframeautoresize && !self.isiframe) {
self.win.scrollTop(0); // reset position
self.doc.height(""); //reset height to fix browser bug
var hh = Math.max(doc.getElementsByTagName('html')[0].scrollHeight, doc.body.scrollHeight);
self.doc.height(hh);
}
self.lazyResize(30);
self.css($(self.iframe.body), _scrollyhidden);
if (cap.isios && self.haswrapper) {
self.css($(doc.body), {
'-webkit-transform': 'translate3d(0,0,0)'
}); // avoid iFrame content clipping - thanks to http://blog.derraab.com/2012/04/02/avoid-iframe-content-clipping-with-css-transform-on-ios/
}
if ('contentWindow' in this) {
self.bind(this.contentWindow, "scroll", self.onscroll); //IE8 & minor
} else {
self.bind(doc, "scroll", self.onscroll);
}
if (opt.enablemousewheel) {
self.mousewheel(doc, self.onmousewheel);
}
if (opt.enablekeyboard) self.bind(doc, (cap.isopera) ? "keypress" : "keydown", self.onkeypress);
if (cap.cantouch) {
self.bind(doc, "touchstart", self.ontouchstart);
self.bind(doc, "touchmove", self.ontouchmove);
}
else if (opt.emulatetouch) {
self.bind(doc, "mousedown", self.ontouchstart);
self.bind(doc, "mousemove", function (e) {
return self.ontouchmove(e, true);
});
if (opt.grabcursorenabled && cap.cursorgrabvalue) self.css($(doc.body), {
'cursor': cap.cursorgrabvalue
});
}
self.bind(doc, "mouseup", self.ontouchend);
if (self.zoom) {
if (opt.dblclickzoom) self.bind(doc, 'dblclick', self.doZoom);
if (self.ongesturezoom) self.bind(doc, "gestureend", self.ongesturezoom);
}
};
if (this.doc[0].readyState && this.doc[0].readyState === "complete") {
setTimeout(function () {
oniframeload.call(self.doc[0], false);
}, 500);
}
self.bind(this.doc, "load", oniframeload);
}
};
this.showCursor = function (py, px) {
if (self.cursortimeout) {
clearTimeout(self.cursortimeout);
self.cursortimeout = 0;
}
if (!self.rail) return;
if (self.autohidedom) {
self.autohidedom.stop().css({
opacity: opt.cursoropacitymax
});
self.cursoractive = true;
}
if (!self.rail.drag || self.rail.drag.pt != 1) {
if (py !== undefined && py !== false) {
self.scroll.y = (py / self.scrollratio.y) | 0;
}
if (px !== undefined) {
self.scroll.x = (px / self.scrollratio.x) | 0;
}
}
self.cursor.css({
height: self.cursorheight,
top: self.scroll.y
});
if (self.cursorh) {
var lx = (self.hasreversehr) ? self.scrollvaluemaxw - self.scroll.x : self.scroll.x;
self.cursorh.css({
width: self.cursorwidth,
left: (!self.rail.align && self.rail.visibility) ? lx + self.rail.width : lx
});
self.cursoractive = true;
}
if (self.zoom) self.zoom.stop().css({
opacity: opt.cursoropacitymax
});
};
this.hideCursor = function (tm) {
if (self.cursortimeout) return;
if (!self.rail) return;
if (!self.autohidedom) return;
if (self.hasmousefocus && opt.autohidemode === "leave") return;
self.cursortimeout = setTimeout(function () {
if (!self.rail.active || !self.showonmouseevent) {
self.autohidedom.stop().animate({
opacity: opt.cursoropacitymin
});
if (self.zoom) self.zoom.stop().animate({
opacity: opt.cursoropacitymin
});
self.cursoractive = false;
}
self.cursortimeout = 0;
}, tm || opt.hidecursordelay);
};
this.noticeCursor = function (tm, py, px) {
self.showCursor(py, px);
if (!self.rail.active) self.hideCursor(tm);
};
this.getContentSize =
(self.ispage) ?
function () {
return {
w: Math.max(_doc.body.scrollWidth, _doc.documentElement.scrollWidth),
h: Math.max(_doc.body.scrollHeight, _doc.documentElement.scrollHeight)
};
} : (self.haswrapper) ?
function () {
return {
w: self.doc[0].offsetWidth,
h: self.doc[0].offsetHeight
};
} : function () {
return {
w: self.docscroll[0].scrollWidth,
h: self.docscroll[0].scrollHeight
};
};
this.onResize = function (e, page) {
if (!self || !self.win) return false;
var premaxh = self.page.maxh,
premaxw = self.page.maxw,
previewh = self.view.h,
previeww = self.view.w;
self.view = {
w: (self.ispage) ? self.win.width() : self.win[0].clientWidth,
h: (self.ispage) ? self.win.height() : self.win[0].clientHeight
};
self.page = (page) ? page : self.getContentSize();
self.page.maxh = Math.max(0, self.page.h - self.view.h);
self.page.maxw = Math.max(0, self.page.w - self.view.w);
if ((self.page.maxh == premaxh) && (self.page.maxw == premaxw) && (self.view.w == previeww) && (self.view.h == previewh)) {
// test position
if (!self.ispage) {
var pos = self.win.offset();
if (self.lastposition) {
var lst = self.lastposition;
if ((lst.top == pos.top) && (lst.left == pos.left)) return self; //nothing to do
}
self.lastposition = pos;
} else {
return self; //nothing to do
}
}
if (self.page.maxh === 0) {
self.hideRail();
self.scrollvaluemax = 0;
self.scroll.y = 0;
self.scrollratio.y = 0;
self.cursorheight = 0;
self.setScrollTop(0);
if (self.rail) self.rail.scrollable = false;
} else {
self.page.maxh -= (opt.railpadding.top + opt.railpadding.bottom);
self.rail.scrollable = true;
}
if (self.page.maxw === 0) {
self.hideRailHr();
self.scrollvaluemaxw = 0;
self.scroll.x = 0;
self.scrollratio.x = 0;
self.cursorwidth = 0;
self.setScrollLeft(0);
if (self.railh) {
self.railh.scrollable = false;
}
} else {
self.page.maxw -= (opt.railpadding.left + opt.railpadding.right);
if (self.railh) self.railh.scrollable = (opt.horizrailenabled);
}
self.railslocked = (self.locked) || ((self.page.maxh === 0) && (self.page.maxw === 0));
if (self.railslocked) {
if (!self.ispage) self.updateScrollBar(self.view);
return false;
}
if (!self.hidden) {
if (!self.rail.visibility) self.showRail();
if (self.railh && !self.railh.visibility) self.showRailHr();
}
if (self.istextarea && self.win.css('resize') && self.win.css('resize') != 'none') self.view.h -= 20;
self.cursorheight = Math.min(self.view.h, Math.round(self.view.h * (self.view.h / self.page.h)));
self.cursorheight = (opt.cursorfixedheight) ? opt.cursorfixedheight : Math.max(opt.cursorminheight, self.cursorheight);
self.cursorwidth = Math.min(self.view.w, Math.round(self.view.w * (self.view.w / self.page.w)));
self.cursorwidth = (opt.cursorfixedheight) ? opt.cursorfixedheight : Math.max(opt.cursorminheight, self.cursorwidth);
self.scrollvaluemax = self.view.h - self.cursorheight - (opt.railpadding.top + opt.railpadding.bottom);
if (!self.hasborderbox) self.scrollvaluemax -= self.cursor[0].offsetHeight - self.cursor[0].clientHeight;
if (self.railh) {
self.railh.width = (self.page.maxh > 0) ? (self.view.w - self.rail.width) : self.view.w;
self.scrollvaluemaxw = self.railh.width - self.cursorwidth - (opt.railpadding.left + opt.railpadding.right);
}
if (!self.ispage) self.updateScrollBar(self.view);
self.scrollratio = {
x: (self.page.maxw / self.scrollvaluemaxw),
y: (self.page.maxh / self.scrollvaluemax)
};
var sy = self.getScrollTop();
if (sy > self.page.maxh) {
self.doScrollTop(self.page.maxh);
} else {
self.scroll.y = (self.getScrollTop() / self.scrollratio.y) | 0;
self.scroll.x = (self.getScrollLeft() / self.scrollratio.x) | 0;
if (self.cursoractive) self.noticeCursor();
}
if (self.scroll.y && (self.getScrollTop() === 0)) self.doScrollTo((self.scroll.y * self.scrollratio.y)|0);
return self;
};
this.resize = self.onResize;
var hlazyresize = 0;
this.onscreenresize = function(e) {
clearTimeout(hlazyresize);
var hiderails = (!self.ispage && !self.haswrapper);
if (hiderails) self.hideRails();
hlazyresize = setTimeout(function () {
if (self) {
if (hiderails) self.showRails();
self.resize();
}
hlazyresize=0;
}, 120);
};
this.lazyResize = function (tm) { // event debounce
clearTimeout(hlazyresize);
tm = isNaN(tm) ? 240 : tm;
hlazyresize = setTimeout(function () {
self && self.resize();
hlazyresize=0;
}, tm);
return self;
};
// derived by MDN https://developer.mozilla.org/en-US/docs/DOM/Mozilla_event_reference/wheel
function _modernWheelEvent(dom, name, fn, bubble) {
self._bind(dom, name, function (e) {
e = e || _win.event;
var event = {
original: e,
target: e.target || e.srcElement,
type: "wheel",
deltaMode: e.type == "MozMousePixelScroll" ? 0 : 1,
deltaX: 0,
deltaZ: 0,
preventDefault: function () {
e.preventDefault ? e.preventDefault() : e.returnValue = false;
return false;
},
stopImmediatePropagation: function () {
(e.stopImmediatePropagation) ? e.stopImmediatePropagation() : e.cancelBubble = true;
}
};
if (name == "mousewheel") {
e.wheelDeltaX && (event.deltaX = -1 / 40 * e.wheelDeltaX);
e.wheelDeltaY && (event.deltaY = -1 / 40 * e.wheelDeltaY);
!event.deltaY && !event.deltaX && (event.deltaY = -1 / 40 * e.wheelDelta);
} else {
event.deltaY = e.detail;
}
return fn.call(dom, event);
}, bubble);
}
this.jqbind = function (dom, name, fn) { // use jquery bind for non-native events (mouseenter/mouseleave)
self.events.push({
e: dom,
n: name,
f: fn,
q: true
});
$(dom).on(name, fn);
};
this.mousewheel = function (dom, fn, bubble) { // bind mousewheel
var el = ("jquery" in dom) ? dom[0] : dom;
if ("onwheel" in _doc.createElement("div")) { // Modern browsers support "wheel"
self._bind(el, "wheel", fn, bubble || false);
} else {
var wname = (_doc.onmousewheel !== undefined) ? "mousewheel" : "DOMMouseScroll"; // older Webkit+IE support or older Firefox
_modernWheelEvent(el, wname, fn, bubble || false);
if (wname == "DOMMouseScroll") _modernWheelEvent(el, "MozMousePixelScroll", fn, bubble || false); // Firefox legacy
}
};
var passiveSupported = false;
if (cap.haseventlistener) { // W3C standard event model
// thanks to https://developer.mozilla.org/en-US/docs/Web/API/EventTarget/addEventListener
try { var options = Object.defineProperty({}, "passive", { get: function () { passiveSupported = !0; } }); _win.addEventListener("test", null, options); } catch (err) { }
this.stopPropagation = function (e) {
if (!e) return false;
e = (e.original) ? e.original : e;
e.stopPropagation();
return false;
};
this.cancelEvent = function(e) {
if (e.cancelable) e.preventDefault();
e.stopImmediatePropagation();
if (e.preventManipulation) e.preventManipulation(); // IE10+
return false;
};
} else {
// inspired from https://gist.github.com/jonathantneal/2415137
Event.prototype.preventDefault = function () {
this.returnValue = false;
};
Event.prototype.stopPropagation = function () {
this.cancelBubble = true;
};
_win.constructor.prototype.addEventListener = _doc.constructor.prototype.addEventListener = Element.prototype.addEventListener = function (type, listener, useCapture) {
this.attachEvent("on" + type, listener);
};
_win.constructor.prototype.removeEventListener = _doc.constructor.prototype.removeEventListener = Element.prototype.removeEventListener = function (type, listener, useCapture) {
this.detachEvent("on" + type, listener);
};
// Thanks to http://www.switchonthecode.com !!
this.cancelEvent = function (e) {
e = e || _win.event;
if (e) {
e.cancelBubble = true;
e.cancel = true;
e.returnValue = false;
}
return false;
};
this.stopPropagation = function (e) {
e = e || _win.event;
if (e) e.cancelBubble = true;
return false;
};
}
this.delegate = function (dom, name, fn, bubble, active) {
var de = delegatevents[name] || false;
if (!de) {
de = {
a: [],
l: [],
f: function (e) {
var lst = de.l, l = lst.length - 1;
var r = false;
for (var a = l; a >= 0; a--) {
r = lst[a].call(e.target, e);
if (r === false) return false;
}
return r;
}
};
self.bind(dom, name, de.f, bubble, active);
delegatevents[name] = de;
}
if (self.ispage) {
de.a = [self.id].concat(de.a);
de.l = [fn].concat(de.l);
} else {
de.a.push(self.id);
de.l.push(fn);
}
};
this.undelegate = function (dom, name, fn, bubble, active) {
var de = delegatevents[name]||false;
if (de&&de.l) { // quick fix #683
for (var a=0,l=de.l.length;a 0) return dd;
dom = (dom.parentNode) ? dom.parentNode : false;
}
return false;
};
this.triggerScrollStart = function (cx, cy, rx, ry, ms) {
if (self.onscrollstart) {
var info = {
type: "scrollstart",
current: {
x: cx,
y: cy
},
request: {
x: rx,
y: ry
},
end: {
x: self.newscrollx,
y: self.newscrolly
},
speed: ms
};
self.onscrollstart.call(self, info);
}
};
this.triggerScrollEnd = function () {
if (self.onscrollend) {
var px = self.getScrollLeft();
var py = self.getScrollTop();
var info = {
type: "scrollend",
current: {
x: px,
y: py
},
end: {
x: px,
y: py
}
};
self.onscrollend.call(self, info);
}
};
var scrolldiry = 0, scrolldirx = 0, scrolltmr = 0, scrollspd = 1;
function doScrollRelative(px, py, chkscroll, iswheel) {
if (!self.scrollrunning) {
self.newscrolly = self.getScrollTop();
self.newscrollx = self.getScrollLeft();
scrolltmr = now();
}
var gap = (now() - scrolltmr);
scrolltmr = now();
if (gap > 350) {
scrollspd = 1;
} else {
scrollspd += (2 - scrollspd) / 10;
}
px = px * scrollspd | 0;
py = py * scrollspd | 0;
if (px) {
if (iswheel) { // mouse-only
if (px < 0) { // fix apple magic mouse swipe back/forward
if (self.getScrollLeft() >= self.page.maxw) return true;
} else {
if (self.getScrollLeft() <= 0) return true;
}
}
var dx = px > 0 ? 1 : -1;
if (scrolldirx !== dx) {
if (self.scrollmom) self.scrollmom.stop();
self.newscrollx = self.getScrollLeft();
scrolldirx = dx;
}
self.lastdeltax -= px;
}
if (py) {
var chk = (function () {
var top = self.getScrollTop();
if (py < 0) {
if (top >= self.page.maxh) return true;
} else {
if (top <= 0) return true;
}
})();
if (chk) {
if (opt.nativeparentscrolling && chkscroll && !self.ispage && !self.zoomactive) return true;
var ny = self.view.h >> 1;
if (self.newscrolly < -ny) { self.newscrolly = -ny; py = -1; }
else if (self.newscrolly > self.page.maxh + ny) { self.newscrolly = self.page.maxh + ny; py = 1; }
else py = 0;
}
var dy = py > 0 ? 1 : -1;
if (scrolldiry !== dy) {
if (self.scrollmom) self.scrollmom.stop();
self.newscrolly = self.getScrollTop();
scrolldiry = dy;
}
self.lastdeltay -= py;
}
if (py || px) {
self.synched("relativexy", function () {
var dty = self.lastdeltay + self.newscrolly;
self.lastdeltay = 0;
var dtx = self.lastdeltax + self.newscrollx;
self.lastdeltax = 0;
if (!self.rail.drag) self.doScrollPos(dtx, dty);
});
}
}
var hasparentscrollingphase = false;
function execScrollWheel(e, hr, chkscroll) {
var px, py;
if (!chkscroll && hasparentscrollingphase) return true;
if (e.deltaMode === 0) { // PIXEL
px = -(e.deltaX * (opt.mousescrollstep / (18 * 3))) | 0;
py = -(e.deltaY * (opt.mousescrollstep / (18 * 3))) | 0;
} else if (e.deltaMode === 1) { // LINE
px = -(e.deltaX * opt.mousescrollstep * 50 / 80) | 0;
py = -(e.deltaY * opt.mousescrollstep * 50 / 80) | 0;
}
if (hr && opt.oneaxismousemode && (px === 0) && py) { // classic vertical-only mousewheel + browser with x/y support
px = py;
py = 0;
if (chkscroll) {
var hrend = (px < 0) ? (self.getScrollLeft() >= self.page.maxw) : (self.getScrollLeft() <= 0);
if (hrend) { // preserve vertical scrolling
py = px;
px = 0;
}
}
}
// invert horizontal direction for rtl mode
if (self.isrtlmode) px = -px;
var chk = doScrollRelative(px, py, chkscroll, true);
if (chk) {
if (chkscroll) hasparentscrollingphase = true;
} else {
hasparentscrollingphase = false;
e.stopImmediatePropagation();
return e.preventDefault();
}
}
this.onmousewheel = function (e) {
if (self.wheelprevented||self.locked) return false;
if (self.railslocked) {
self.debounced("checkunlock", self.resize, 250);
return false;
}
if (self.rail.drag) return self.cancelEvent(e);
if (opt.oneaxismousemode === "auto" && e.deltaX !== 0) opt.oneaxismousemode = false; // check two-axis mouse support (not very elegant)
if (opt.oneaxismousemode && e.deltaX === 0) {
if (!self.rail.scrollable) {
if (self.railh && self.railh.scrollable) {
return self.onmousewheelhr(e);
} else {
return true;
}
}
}
var nw = now();
var chk = false;
if (opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
self.nativescrollingarea = self.isScrollable(e);
chk = true;
}
self.checkarea = nw;
if (self.nativescrollingarea) return true; // this isn't my business
var ret = execScrollWheel(e, false, chk);
if (ret) self.checkarea = 0;
return ret;
};
this.onmousewheelhr = function (e) {
if (self.wheelprevented) return;
if (self.railslocked || !self.railh.scrollable) return true;
if (self.rail.drag) return self.cancelEvent(e);
var nw = now();
var chk = false;
if (opt.preservenativescrolling && ((self.checkarea + 600) < nw)) {
self.nativescrollingarea = self.isScrollable(e);
chk = true;
}
self.checkarea = nw;
if (self.nativescrollingarea) return true; // this is not my business
if (self.railslocked) return self.cancelEvent(e);
return execScrollWheel(e, true, chk);
};
this.stop = function () {
self.cancelScroll();
if (self.scrollmon) self.scrollmon.stop();
self.cursorfreezed = false;
self.scroll.y = Math.round(self.getScrollTop() * (1 / self.scrollratio.y));
self.noticeCursor();
return self;
};
this.getTransitionSpeed = function (dif) {
return 80 + (dif / 72) * opt.scrollspeed |0;
};
if (!opt.smoothscroll) {
this.doScrollLeft = function (x, spd) { //direct
var y = self.getScrollTop();
self.doScrollPos(x, y, spd);
};
this.doScrollTop = function (y, spd) { //direct
var x = self.getScrollLeft();
self.doScrollPos(x, y, spd);
};
this.doScrollPos = function (x, y, spd) { //direct
var nx = (x > self.page.maxw) ? self.page.maxw : x;
if (nx < 0) nx = 0;
var ny = (y > self.page.maxh) ? self.page.maxh : y;
if (ny < 0) ny = 0;
self.synched('scroll', function () {
self.setScrollTop(ny);
self.setScrollLeft(nx);
});
};
this.cancelScroll = function () { }; // direct
} else if (self.ishwscroll && cap.hastransition && opt.usetransition && !!opt.smoothscroll) {
var lasttransitionstyle = '';
this.resetTransition = function () {
lasttransitionstyle = '';
self.doc.css(cap.prefixstyle + 'transition-duration', '0ms');
};
this.prepareTransition = function (dif, istime) {
var ex = (istime) ? dif : self.getTransitionSpeed(dif);
var trans = ex + 'ms';
if (lasttransitionstyle !== trans) {
lasttransitionstyle = trans;
self.doc.css(cap.prefixstyle + 'transition-duration', trans);
}
return ex;
};
this.doScrollLeft = function (x, spd) { //trans
var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
self.doScrollPos(x, y, spd);
};
this.doScrollTop = function (y, spd) { //trans
var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
self.doScrollPos(x, y, spd);
};
this.cursorupdate = {
running: false,
start: function () {
var m = this;
if (m.running) return;
m.running = true;
var loop = function () {
if (m.running) setAnimationFrame(loop);
self.showCursor(self.getScrollTop(), self.getScrollLeft());
self.notifyScrollEvent(self.win[0]);
};
setAnimationFrame(loop);
},
stop: function () {
this.running = false;
}
};
this.doScrollPos = function (x, y, spd) { //trans
var py = self.getScrollTop();
var px = self.getScrollLeft();
if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
if (!opt.bouncescroll) {
if (y < 0) y = 0;
else if (y > self.page.maxh) y = self.page.maxh;
if (x < 0) x = 0;
else if (x > self.page.maxw) x = self.page.maxw;
} else {
if (y < 0) y = y / 2 | 0;
else if (y > self.page.maxh) y = self.page.maxh + (y - self.page.maxh) / 2 | 0;
if (x < 0) x = x / 2 | 0;
else if (x > self.page.maxw) x = self.page.maxw + (x - self.page.maxw) / 2 | 0;
}
if (self.scrollrunning && x == self.newscrollx && y == self.newscrolly) return false;
self.newscrolly = y;
self.newscrollx = x;
var top = self.getScrollTop();
var lft = self.getScrollLeft();
var dst = {};
dst.x = x - lft;
dst.y = y - top;
var dd = Math.sqrt((dst.x * dst.x) + (dst.y * dst.y)) | 0;
var ms = self.prepareTransition(dd);
if (!self.scrollrunning) {
self.scrollrunning = true;
self.triggerScrollStart(lft, top, x, y, ms);
self.cursorupdate.start();
}
self.scrollendtrapped = true;
if (!cap.transitionend) {
if (self.scrollendtrapped) clearTimeout(self.scrollendtrapped);
self.scrollendtrapped = setTimeout(self.onScrollTransitionEnd, ms); // simulate transitionend event
}
self.setScrollTop(self.newscrolly);
self.setScrollLeft(self.newscrollx);
};
this.cancelScroll = function () {
if (!self.scrollendtrapped) return true;
var py = self.getScrollTop();
var px = self.getScrollLeft();
self.scrollrunning = false;
if (!cap.transitionend) clearTimeout(cap.transitionend);
self.scrollendtrapped = false;
self.resetTransition();
self.setScrollTop(py); // fire event onscroll
if (self.railh) self.setScrollLeft(px);
if (self.timerscroll && self.timerscroll.tm) clearInterval(self.timerscroll.tm);
self.timerscroll = false;
self.cursorfreezed = false;
self.cursorupdate.stop();
self.showCursor(py, px);
return self;
};
this.onScrollTransitionEnd = function () {
if (!self.scrollendtrapped) return;
var py = self.getScrollTop();
var px = self.getScrollLeft();
if (py < 0) py = 0;
else if (py > self.page.maxh) py = self.page.maxh;
if (px < 0) px = 0;
else if (px > self.page.maxw) px = self.page.maxw;
if ((py != self.newscrolly) || (px != self.newscrollx)) return self.doScrollPos(px, py, opt.snapbackspeed);
if (self.scrollrunning) self.triggerScrollEnd();
self.scrollrunning = false;
self.scrollendtrapped = false;
self.resetTransition();
self.timerscroll = false;
self.setScrollTop(py); // fire event onscroll
if (self.railh) self.setScrollLeft(px); // fire event onscroll left
self.cursorupdate.stop();
self.noticeCursor(false, py, px);
self.cursorfreezed = false;
};
} else {
this.doScrollLeft = function (x, spd) { //no-trans
var y = (self.scrollrunning) ? self.newscrolly : self.getScrollTop();
self.doScrollPos(x, y, spd);
};
this.doScrollTop = function (y, spd) { //no-trans
var x = (self.scrollrunning) ? self.newscrollx : self.getScrollLeft();
self.doScrollPos(x, y, spd);
};
this.doScrollPos = function (x, y, spd) { //no-trans
var py = self.getScrollTop();
var px = self.getScrollLeft();
if (((self.newscrolly - py) * (y - py) < 0) || ((self.newscrollx - px) * (x - px) < 0)) self.cancelScroll(); //inverted movement detection
var clipped = false;
if (!self.bouncescroll || !self.rail.visibility) {
if (y < 0) {
y = 0;
clipped = true;
} else if (y > self.page.maxh) {
y = self.page.maxh;
clipped = true;
}
}
if (!self.bouncescroll || !self.railh.visibility) {
if (x < 0) {
x = 0;
clipped = true;
} else if (x > self.page.maxw) {
x = self.page.maxw;
clipped = true;
}
}
if (self.scrollrunning && (self.newscrolly === y) && (self.newscrollx === x)) return true;
self.newscrolly = y;
self.newscrollx = x;
self.dst = {};
self.dst.x = x - px;
self.dst.y = y - py;
self.dst.px = px;
self.dst.py = py;
var dd = Math.sqrt((self.dst.x * self.dst.x) + (self.dst.y * self.dst.y)) | 0;
var ms = self.getTransitionSpeed(dd);
self.bzscroll = {};
var p3 = (clipped) ? 1 : 0.58;
self.bzscroll.x = new BezierClass(px, self.newscrollx, ms, 0, 0, p3, 1);
self.bzscroll.y = new BezierClass(py, self.newscrolly, ms, 0, 0, p3, 1);
var loopid = now();
var loop = function () {
if (!self.scrollrunning) return;
var x = self.bzscroll.y.getPos();
self.setScrollLeft(self.bzscroll.x.getNow());
self.setScrollTop(self.bzscroll.y.getNow());
if (x <= 1) {
self.timer = setAnimationFrame(loop);
} else {
self.scrollrunning = false;
self.timer = 0;
self.triggerScrollEnd();
}
};
if (!self.scrollrunning) {
self.triggerScrollStart(px, py, x, y, ms);
self.scrollrunning = true;
self.timer = setAnimationFrame(loop);
}
};
this.cancelScroll = function () {
if (self.timer) clearAnimationFrame(self.timer);
self.timer = 0;
self.bzscroll = false;
self.scrollrunning = false;
return self;
};
}
this.doScrollBy = function (stp, relative) {
doScrollRelative(0, stp);
};
this.doScrollLeftBy = function (stp, relative) {
doScrollRelative(stp, 0);
};
this.doScrollTo = function (pos, relative) {
var ny = (relative) ? Math.round(pos * self.scrollratio.y) : pos;
if (ny < 0) ny = 0;
else if (ny > self.page.maxh) ny = self.page.maxh;
self.cursorfreezed = false;
self.doScrollTop(pos);
};
this.checkContentSize = function () {
var pg = self.getContentSize();
if ((pg.h != self.page.h) || (pg.w != self.page.w)) self.resize(false, pg);
};
self.onscroll = function (e) {
if (self.rail.drag) return;
if (!self.cursorfreezed) {
self.synched('scroll', function () {
self.scroll.y = Math.round(self.getScrollTop() / self.scrollratio.y);
if (self.railh) self.scroll.x = Math.round(self.getScrollLeft() / self.scrollratio.x);
self.noticeCursor();
});
}
};
self.bind(self.docscroll, "scroll", self.onscroll);
this.doZoomIn = function (e) {
if (self.zoomactive) return;
self.zoomactive = true;
self.zoomrestore = {
style: {}
};
var lst = ['position', 'top', 'left', 'zIndex', 'backgroundColor', 'marginTop', 'marginBottom', 'marginLeft', 'marginRight'];
var win = self.win[0].style;
for (var a in lst) {
var pp = lst[a];
self.zoomrestore.style[pp] = (win[pp] !== undefined) ? win[pp] : '';
}
self.zoomrestore.style.width = self.win.css('width');
self.zoomrestore.style.height = self.win.css('height');
self.zoomrestore.padding = {
w: self.win.outerWidth() - self.win.width(),
h: self.win.outerHeight() - self.win.height()
};
if (cap.isios4) {
self.zoomrestore.scrollTop = $window.scrollTop();
$window.scrollTop(0);
}
self.win.css({
position: (cap.isios4) ? "absolute" : "fixed",
top: 0,
left: 0,
zIndex: globalmaxzindex + 100,
margin: 0
});
var bkg = self.win.css("backgroundColor");
if ("" === bkg || /transparent|rgba\(0, 0, 0, 0\)|rgba\(0,0,0,0\)/.test(bkg)) self.win.css("backgroundColor", "#fff");
self.rail.css({
zIndex: globalmaxzindex + 101
});
self.zoom.css({
zIndex: globalmaxzindex + 102
});
self.zoom.css('backgroundPosition', '0 -18px');
self.resizeZoom();
if (self.onzoomin) self.onzoomin.call(self);
return self.cancelEvent(e);
};
this.doZoomOut = function (e) {
if (!self.zoomactive) return;
self.zoomactive = false;
self.win.css("margin", "");
self.win.css(self.zoomrestore.style);
if (cap.isios4) {
$window.scrollTop(self.zoomrestore.scrollTop);
}
self.rail.css({
"z-index": self.zindex
});
self.zoom.css({
"z-index": self.zindex
});
self.zoomrestore = false;
self.zoom.css('backgroundPosition', '0 0');
self.onResize();
if (self.onzoomout) self.onzoomout.call(self);
return self.cancelEvent(e);
};
this.doZoom = function (e) {
return (self.zoomactive) ? self.doZoomOut(e) : self.doZoomIn(e);
};
this.resizeZoom = function () {
if (!self.zoomactive) return;
var py = self.getScrollTop(); //preserve scrolling position
self.win.css({
width: $window.width() - self.zoomrestore.padding.w + "px",
height: $window.height() - self.zoomrestore.padding.h + "px"
});
self.onResize();
self.setScrollTop(Math.min(self.page.maxh, py));
};
this.init();
$.nicescroll.push(this);
};
// Inspired by the work of Kin Blas
// http://webpro.host.adobe.com/people/jblas/momentum/includes/jquery.momentum.0.7.js
var ScrollMomentumClass2D = function (nc) {
var self = this;
this.nc = nc;
this.lastx = 0;
this.lasty = 0;
this.speedx = 0;
this.speedy = 0;
this.lasttime = 0;
this.steptime = 0;
this.snapx = false;
this.snapy = false;
this.demulx = 0;
this.demuly = 0;
this.lastscrollx = -1;
this.lastscrolly = -1;
this.chkx = 0;
this.chky = 0;
this.timer = 0;
this.reset = function (px, py) {
self.stop();
self.steptime = 0;
self.lasttime = now();
self.speedx = 0;
self.speedy = 0;
self.lastx = px;
self.lasty = py;
self.lastscrollx = -1;
self.lastscrolly = -1;
};
this.update = function (px, py) {
var tm = now();
self.steptime = tm - self.lasttime;
self.lasttime = tm;
var dy = py - self.lasty;
var dx = px - self.lastx;
var sy = self.nc.getScrollTop();
var sx = self.nc.getScrollLeft();
var newy = sy + dy;
var newx = sx + dx;
self.snapx = (newx < 0) || (newx > self.nc.page.maxw);
self.snapy = (newy < 0) || (newy > self.nc.page.maxh);
self.speedx = dx;
self.speedy = dy;
self.lastx = px;
self.lasty = py;
};
this.stop = function () {
self.nc.unsynched("domomentum2d");
if (self.timer) clearTimeout(self.timer);
self.timer = 0;
self.lastscrollx = -1;
self.lastscrolly = -1;
};
this.doSnapy = function (nx, ny) {
var snap = false;
if (ny < 0) {
ny = 0;
snap = true;
} else if (ny > self.nc.page.maxh) {
ny = self.nc.page.maxh;
snap = true;
}
if (nx < 0) {
nx = 0;
snap = true;
} else if (nx > self.nc.page.maxw) {
nx = self.nc.page.maxw;
snap = true;
}
(snap) ? self.nc.doScrollPos(nx, ny, self.nc.opt.snapbackspeed) : self.nc.triggerScrollEnd();
};
this.doMomentum = function (gp) {
var t = now();
var l = (gp) ? t + gp : self.lasttime;
var sl = self.nc.getScrollLeft();
var st = self.nc.getScrollTop();
var pageh = self.nc.page.maxh;
var pagew = self.nc.page.maxw;
self.speedx = (pagew > 0) ? Math.min(60, self.speedx) : 0;
self.speedy = (pageh > 0) ? Math.min(60, self.speedy) : 0;
var chk = l && (t - l) <= 60;
if ((st < 0) || (st > pageh) || (sl < 0) || (sl > pagew)) chk = false;
var sy = (self.speedy && chk) ? self.speedy : false;
var sx = (self.speedx && chk) ? self.speedx : false;
if (sy || sx) {
var tm = Math.max(16, self.steptime); //timeout granularity
if (tm > 50) { // do smooth
var xm = tm / 50;
self.speedx *= xm;
self.speedy *= xm;
tm = 50;
}
self.demulxy = 0;
self.lastscrollx = self.nc.getScrollLeft();
self.chkx = self.lastscrollx;
self.lastscrolly = self.nc.getScrollTop();
self.chky = self.lastscrolly;
var nx = self.lastscrollx;
var ny = self.lastscrolly;
var onscroll = function () {
var df = ((now() - t) > 600) ? 0.04 : 0.02;
if (self.speedx) {
nx = Math.floor(self.lastscrollx - (self.speedx * (1 - self.demulxy)));
self.lastscrollx = nx;
if ((nx < 0) || (nx > pagew)) df = 0.10;
}
if (self.speedy) {
ny = Math.floor(self.lastscrolly - (self.speedy * (1 - self.demulxy)));
self.lastscrolly = ny;
if ((ny < 0) || (ny > pageh)) df = 0.10;
}
self.demulxy = Math.min(1, self.demulxy + df);
self.nc.synched("domomentum2d", function () {
if (self.speedx) {
var scx = self.nc.getScrollLeft();
// if (scx != self.chkx) self.stop();
self.chkx = nx;
self.nc.setScrollLeft(nx);
}
if (self.speedy) {
var scy = self.nc.getScrollTop();
// if (scy != self.chky) self.stop();
self.chky = ny;
self.nc.setScrollTop(ny);
}
if (!self.timer) {
self.nc.hideCursor();
self.doSnapy(nx, ny);
}
});
if (self.demulxy < 1) {
self.timer = setTimeout(onscroll, tm);
} else {
self.stop();
self.nc.hideCursor();
self.doSnapy(nx, ny);
}
};
onscroll();
} else {
self.doSnapy(self.nc.getScrollLeft(), self.nc.getScrollTop());
}
};
};
// override jQuery scrollTop
var _scrollTop = jQuery.fn.scrollTop; // preserve original function
jQuery.cssHooks.pageYOffset = {
get: function (elem, computed, extra) {
var nice = $.data(elem, '__nicescroll') || false;
return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(elem);
},
set: function (elem, value) {
var nice = $.data(elem, '__nicescroll') || false;
(nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call(elem, value);
return this;
}
};
jQuery.fn.scrollTop = function (value) {
if (value === undefined) {
var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
return (nice && nice.ishwscroll) ? nice.getScrollTop() : _scrollTop.call(this);
} else {
return this.each(function () {
var nice = $.data(this, '__nicescroll') || false;
(nice && nice.ishwscroll) ? nice.setScrollTop(parseInt(value)) : _scrollTop.call($(this), value);
});
}
};
// override jQuery scrollLeft
var _scrollLeft = jQuery.fn.scrollLeft; // preserve original function
$.cssHooks.pageXOffset = {
get: function (elem, computed, extra) {
var nice = $.data(elem, '__nicescroll') || false;
return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(elem);
},
set: function (elem, value) {
var nice = $.data(elem, '__nicescroll') || false;
(nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call(elem, value);
return this;
}
};
jQuery.fn.scrollLeft = function (value) {
if (value === undefined) {
var nice = (this[0]) ? $.data(this[0], '__nicescroll') || false : false;
return (nice && nice.ishwscroll) ? nice.getScrollLeft() : _scrollLeft.call(this);
} else {
return this.each(function () {
var nice = $.data(this, '__nicescroll') || false;
(nice && nice.ishwscroll) ? nice.setScrollLeft(parseInt(value)) : _scrollLeft.call($(this), value);
});
}
};
var NiceScrollArray = function (doms) {
var self = this;
this.length = 0;
this.name = "nicescrollarray";
this.each = function (fn) {
$.each(self, fn);
return self;
};
this.push = function (nice) {
self[self.length] = nice;
self.length++;
};
this.eq = function (idx) {
return self[idx];
};
if (doms) {
for (var a = 0; a < doms.length; a++) {
var nice = $.data(doms[a], '__nicescroll') || false;
if (nice) {
this[this.length] = nice;
this.length++;
}
}
}
return this;
};
function mplex(el, lst, fn) {
for (var a = 0, l = lst.length; a < l; a++) fn(el, lst[a]);
}
mplex(
NiceScrollArray.prototype, ['show', 'hide', 'toggle', 'onResize', 'resize', 'remove', 'stop', 'doScrollPos'],
function (e, n) {
e[n] = function () {
var args = arguments;
return this.each(function () {
this[n].apply(this, args);
});
};
}
);
jQuery.fn.getNiceScroll = function (index) {
if (index === undefined) {
return new NiceScrollArray(this);
} else {
return this[index] && $.data(this[index], '__nicescroll') || false;
}
};
var pseudos = jQuery.expr.pseudos || jQuery.expr[':']; // jQuery 3 migration
pseudos.nicescroll = function (a) {
return $.data(a, '__nicescroll') !== undefined;
};
$.fn.niceScroll = function (wrapper, _opt) {
if (_opt === undefined && typeof wrapper == "object" && !("jquery" in wrapper)) {
_opt = wrapper;
wrapper = false;
}
var ret = new NiceScrollArray();
this.each(function () {
var $this = $(this);
var opt = $.extend({}, _opt); // cloning
if (wrapper || false) {
var wrp = $(wrapper);
opt.doc = (wrp.length > 1) ? $(wrapper, $this) : wrp;
opt.win = $this;
}
var docundef = !("doc" in opt);
if (!docundef && !("win" in opt)) opt.win = $this;
var nice = $this.data('__nicescroll') || false;
if (!nice) {
opt.doc = opt.doc || $this;
nice = new NiceScrollClass(opt, $this);
$this.data('__nicescroll', nice);
}
ret.push(nice);
});
return (ret.length === 1) ? ret[0] : ret;
};
_win.NiceScroll = {
getjQuery: function () {
return jQuery;
}
};
if (!$.nicescroll) {
$.nicescroll = new NiceScrollArray();
$.nicescroll.options = _globaloptions;
}
}));